About 4-(aminomethyl)-1-[2-(1,3-oxazol-5-yl)ethyl]pyrrolidin-2-one
4-(aminomethyl)-1-[2-(1,3-oxazol-5-yl)ethyl]pyrrolidin-2-one (PubChem CID 168660275) has the molecular formula C10H15N3O2
and a molecular weight of 209.25 g/mol. Its IUPAC name is 4-(aminomethyl)-1-[2-(1,3-oxazol-5-yl)ethyl]pyrrolidin-2-one.
Molecular Properties
| Compound Name | 4-(aminomethyl)-1-[2-(1,3-oxazol-5-yl)ethyl]pyrrolidin-2-one |
| PubChem CID | 168660275 |
| Molecular Formula | C10H15N3O2 |
| Molecular Weight | 209.25 g/mol |
| Exact Mass | 209.12 |
| IUPAC Name | 4-(aminomethyl)-1-[2-(1,3-oxazol-5-yl)ethyl]pyrrolidin-2-one |
| SMILES | NCC1CC(=O)N(CCc2cnco2)C1 |
| InChI | InChI=1S/C10H15N3O2/c11-4-8-3-10(14)13(6-8)2-1-9-5-12-7-15-9/h5,7-8H,1-4,6,11H2 |
| InChIKey | ADONSFQQEUWKSW-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 72.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.25 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-(aminomethyl)-1-[2-(1,3-oxazol-5-yl)ethyl]pyrrolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(aminomethyl)-1-[2-(1,3-oxazol-5-yl)ethyl]pyrrolidin-2-one?
The IUPAC name of 4-(aminomethyl)-1-[2-(1,3-oxazol-5-yl)ethyl]pyrrolidin-2-one (CID 168660275) is 4-(aminomethyl)-1-[2-(1,3-oxazol-5-yl)ethyl]pyrrolidin-2-one.
What is the SMILES notation for 4-(aminomethyl)-1-[2-(1,3-oxazol-5-yl)ethyl]pyrrolidin-2-one?
The canonical SMILES for 4-(aminomethyl)-1-[2-(1,3-oxazol-5-yl)ethyl]pyrrolidin-2-one is NCC1CC(=O)N(CCc2cnco2)C1.
What is the InChIKey of 4-(aminomethyl)-1-[2-(1,3-oxazol-5-yl)ethyl]pyrrolidin-2-one?
The InChIKey is ADONSFQQEUWKSW-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15N3O2/c11-4-8-3-10(14)13(6-8)2-1-9-5-12-7-15-9/h5,7-8H,1-4,6,11H2.
What are the key properties of 4-(aminomethyl)-1-[2-(1,3-oxazol-5-yl)ethyl]pyrrolidin-2-one?
4-(aminomethyl)-1-[2-(1,3-oxazol-5-yl)ethyl]pyrrolidin-2-one has a molecular weight of 209.25 g/mol, XLogP of 0.02, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(aminomethyl)-1-[2-(1,3-oxazol-5-yl)ethyl]pyrrolidin-2-one is sourced from PubChem (CID 168660275), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).