C14H16N4O — CID 168661209
4-(aminomethyl)-1-(3-pyrazol-1-ylphenyl)pyrrolidin-2-one (PubChem CID 168661209) has the molecular formula C14H16N4O and a molecular weight of 256.31 g/mol. Its IUPAC name is 4-(aminomethyl)-1-(3-pyrazol-1-ylphenyl)pyrrolidin-2-one.
| Compound Name | 4-(aminomethyl)-1-(3-pyrazol-1-ylphenyl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 168661209 |
| Molecular Formula | C14H16N4O |
| Molecular Weight | 256.31 g/mol |
| Exact Mass | 256.13 |
| IUPAC Name | 4-(aminomethyl)-1-(3-pyrazol-1-ylphenyl)pyrrolidin-2-one |
| SMILES | NCC1CC(=O)N(c2cccc(-n3cccn3)c2)C1 |
| InChI | InChI=1S/C14H16N4O/c15-9-11-7-14(19)17(10-11)12-3-1-4-13(8-12)18-6-2-5-16-18/h1-6,8,11H,7,9-10,15H2 |
| InChIKey | SAXSSOHUZYKBHH-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 64.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.31 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |