C9H10N4OS2 — CID 168661430
[2-[4-(aminomethyl)-2-oxopyrrolidin-1-yl]-1,3-thiazol-5-yl] thiocyanate (PubChem CID 168661430) has the molecular formula C9H10N4OS2 and a molecular weight of 254.34 g/mol. Its IUPAC name is [2-[4-(aminomethyl)-2-oxopyrrolidin-1-yl]-1,3-thiazol-5-yl] thiocyanate.
| Compound Name | [2-[4-(aminomethyl)-2-oxopyrrolidin-1-yl]-1,3-thiazol-5-yl] thiocyanate |
|---|---|
| PubChem CID | 168661430 |
| Molecular Formula | C9H10N4OS2 |
| Molecular Weight | 254.34 g/mol |
| Exact Mass | 254.03 |
| IUPAC Name | [2-[4-(aminomethyl)-2-oxopyrrolidin-1-yl]-1,3-thiazol-5-yl] thiocyanate |
| SMILES | N#CSc1cnc(N2CC(CN)CC2=O)s1 |
| InChI | InChI=1S/C9H10N4OS2/c10-2-6-1-7(14)13(4-6)9-12-3-8(16-9)15-5-11/h3,6H,1-2,4,10H2 |
| InChIKey | WPKTWPCGXARJHW-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 83.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.34 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|