C22H24N4O2 — CID 16866425
N-(2,5-dimethylphenyl)-1-(1H-indazole-3-carbonyl)piperidine-4-carboxamide (PubChem CID 16866425) has the molecular formula C22H24N4O2 and a molecular weight of 376.46 g/mol. Its IUPAC name is N-(2,5-dimethylphenyl)-1-(1H-indazole-3-carbonyl)piperidine-4-carboxamide.
| Compound Name | N-(2,5-dimethylphenyl)-1-(1H-indazole-3-carbonyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 16866425 |
| Molecular Formula | C22H24N4O2 |
| Molecular Weight | 376.46 g/mol |
| Exact Mass | 376.19 |
| IUPAC Name | N-(2,5-dimethylphenyl)-1-(1H-indazole-3-carbonyl)piperidine-4-carboxamide |
| SMILES | Cc1ccc(C)c(NC(=O)C2CCN(C(=O)c3n[nH]c4ccccc34)CC2)c1 |
| InChI | InChI=1S/C22H24N4O2/c1-14-7-8-15(2)19(13-14)23-21(27)16-9-11-26(12-10-16)22(28)20-17-5-3-4-6-18(17)24-25-20/h3-8,13,16H,9-12H2,1-2H3,(H,23,27)(H,24,25) |
| InChIKey | NHGOQWBJDTUNNE-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 78.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.46 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |