C37H56O7 — CID 168664510
5-[[(4R,6aR,6bS,8aS,14bR)-8a-ethoxycarbonyl-4,6a,6b,11,11,14b-hexamethyl-3-oxo-2,4a,5,6,7,8,9,10,12,12a,14,14a-dodecahydro-1H-picen-4-yl]methoxy]-5-oxopentanoic acid (PubChem CID 168664510) has the molecular formula C37H56O7 and a molecular weight of 612.85 g/mol. Its IUPAC name is 5-[[(4R,6aR,6bS,8aS,14bR)-8a-ethoxycarbonyl-4,6a,6b,11,11,14b-hexamethyl-3-oxo-2,4a,5,6,7,8,9,10,12,12a,14,14a-dodecahydro-1H-picen-4-yl]methoxy]-5-oxopentanoic acid.
| Compound Name | 5-[[(4R,6aR,6bS,8aS,14bR)-8a-ethoxycarbonyl-4,6a,6b,11,11,14b-hexamethyl-3-oxo-2,4a,5,6,7,8,9,10,12,12a,14,14a-dodecahydro-1H-picen-4-yl]methoxy]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 168664510 |
| Molecular Formula | C37H56O7 |
| Molecular Weight | 612.85 g/mol |
| Exact Mass | 612.40 |
| IUPAC Name | 5-[[(4R,6aR,6bS,8aS,14bR)-8a-ethoxycarbonyl-4,6a,6b,11,11,14b-hexamethyl-3-oxo-2,4a,5,6,7,8,9,10,12,12a,14,14a-dodecahydro-1H-picen-4-yl]methoxy]-5-oxopentanoic acid |
| SMILES | CCOC(=O)[C@]12CCC(C)(C)CC1C1=CCC3[C@@]4(C)CCC(=O)[C@@](C)(COC(=O)CCCC(=O)O)C4CC[C@@]3(C)[C@]1(C)CC2 |
| InChI | InChI=1S/C37H56O7/c1-8-43-31(42)37-20-18-32(2,3)22-25(37)24-12-13-27-33(4)16-15-28(38)34(5,23-44-30(41)11-9-10-29(39)40)26(33)14-17-36(27,7)35(24,6)19-21-37/h12,25-27H,8-11,13-23H2,1-7H3,(H,39,40)/t25?,26?,27?,33-,34-,35+,36+,37-/m0/s1 |
| InChIKey | HSRFNOHJTIAQAS-ZOCGDBPVSA-N |
| XLogP | 7.70 |
| TPSA | 106.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.85 |
| LogP ≤ 5 | 7.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|