C38H64O4Si — CID 168664694
ethyl (4aS,6aS,6bR,9R,12aR)-9-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2,6a,6b,9,12a-hexamethyl-10-oxo-3,4,5,6,6a,7,8,8a,11,12,13,14b-dodecahydro-1H-picene-4a-carboxylate (PubChem CID 168664694) has the molecular formula C38H64O4Si and a molecular weight of 613.01 g/mol. Its IUPAC name is ethyl (4aS,6aS,6bR,9R,12aR)-9-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2,6a,6b,9,12a-hexamethyl-10-oxo-3,4,5,6,6a,7,8,8a,11,12,13,14b-dodecahydro-1H-picene-4a-carboxylate.
| Compound Name | ethyl (4aS,6aS,6bR,9R,12aR)-9-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2,6a,6b,9,12a-hexamethyl-10-oxo-3,4,5,6,6a,7,8,8a,11,12,13,14b-dodecahydro-1H-picene-4a-carboxylate |
|---|---|
| PubChem CID | 168664694 |
| Molecular Formula | C38H64O4Si |
| Molecular Weight | 613.01 g/mol |
| Exact Mass | 612.46 |
| IUPAC Name | ethyl (4aS,6aS,6bR,9R,12aR)-9-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2,6a,6b,9,12a-hexamethyl-10-oxo-3,4,5,6,6a,7,8,8a,11,12,13,14b-dodecahydro-1H-picene-4a-carboxylate |
| SMILES | CCOC(=O)[C@]12CCC(C)(C)CC1C1=CCC3[C@@]4(C)CCC(=O)[C@@](C)(CO[Si](C)(C)C(C)(C)C)C4CC[C@@]3(C)[C@]1(C)CC2 |
| InChI | InChI=1S/C38H64O4Si/c1-13-41-31(40)38-22-20-33(5,6)24-27(38)26-14-15-29-34(7)18-17-30(39)35(8,25-42-43(11,12)32(2,3)4)28(34)16-19-37(29,10)36(26,9)21-23-38/h14,27-29H,13,15-25H2,1-12H3/t27?,28?,29?,34-,35-,36+,37+,38-/m0/s1 |
| InChIKey | CRRFGXZCNYGPAO-SNBXFDNDSA-N |
| XLogP | 9.92 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.01 |
| LogP ≤ 5 | 9.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|