C32H35N5O3 — CID 168665169
4-[2,3-bis(4-morpholin-4-ylphenyl)quinoxalin-6-yl]morpholine (PubChem CID 168665169) has the molecular formula C32H35N5O3 and a molecular weight of 537.66 g/mol. Its IUPAC name is 4-[2,3-bis(4-morpholin-4-ylphenyl)quinoxalin-6-yl]morpholine.
| Compound Name | 4-[2,3-bis(4-morpholin-4-ylphenyl)quinoxalin-6-yl]morpholine |
|---|---|
| PubChem CID | 168665169 |
| Molecular Formula | C32H35N5O3 |
| Molecular Weight | 537.66 g/mol |
| Exact Mass | 537.27 |
| IUPAC Name | 4-[2,3-bis(4-morpholin-4-ylphenyl)quinoxalin-6-yl]morpholine |
| SMILES | c1cc(N2CCOCC2)ccc1-c1nc2ccc(N3CCOCC3)cc2nc1-c1ccc(N2CCOCC2)cc1 |
| InChI | InChI=1S/C32H35N5O3/c1-5-26(35-11-17-38-18-12-35)6-2-24(1)31-32(25-3-7-27(8-4-25)36-13-19-39-20-14-36)34-30-23-28(9-10-29(30)33-31)37-15-21-40-22-16-37/h1-10,23H,11-22H2 |
| InChIKey | OJNILUMXXOZKFD-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 63.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.66 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |