About 1-[4-(2,4,5-trifluorophenyl)phenyl]ethanamine;hydrochloride
1-[4-(2,4,5-trifluorophenyl)phenyl]ethanamine;hydrochloride (PubChem CID 168665288) has the molecular formula C14H13ClF3N
and a molecular weight of 287.71 g/mol. Its IUPAC name is 1-[4-(2,4,5-trifluorophenyl)phenyl]ethanamine;hydrochloride.
Molecular Properties
| Compound Name | 1-[4-(2,4,5-trifluorophenyl)phenyl]ethanamine;hydrochloride |
| PubChem CID | 168665288 |
| Molecular Formula | C14H13ClF3N |
| Molecular Weight | 287.71 g/mol |
| Exact Mass | 287.07 |
| IUPAC Name | 1-[4-(2,4,5-trifluorophenyl)phenyl]ethanamine;hydrochloride |
| SMILES | CC(N)c1ccc(-c2cc(F)c(F)cc2F)cc1.Cl |
| InChI | InChI=1S/C14H12F3N.ClH/c1-8(18)9-2-4-10(5-3-9)11-6-13(16)14(17)7-12(11)15;/h2-8H,18H2,1H3;1H |
| InChIKey | UZTIUOOBUGTUCD-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.71 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|
Analyze 1-[4-(2,4,5-trifluorophenyl)phenyl]ethanamine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[4-(2,4,5-trifluorophenyl)phenyl]ethanamine;hydrochloride?
The IUPAC name of 1-[4-(2,4,5-trifluorophenyl)phenyl]ethanamine;hydrochloride (CID 168665288) is 1-[4-(2,4,5-trifluorophenyl)phenyl]ethanamine;hydrochloride.
What is the SMILES notation for 1-[4-(2,4,5-trifluorophenyl)phenyl]ethanamine;hydrochloride?
The canonical SMILES for 1-[4-(2,4,5-trifluorophenyl)phenyl]ethanamine;hydrochloride is CC(N)c1ccc(-c2cc(F)c(F)cc2F)cc1.Cl.
What is the InChIKey of 1-[4-(2,4,5-trifluorophenyl)phenyl]ethanamine;hydrochloride?
The InChIKey is UZTIUOOBUGTUCD-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12F3N.ClH/c1-8(18)9-2-4-10(5-3-9)11-6-13(16)14(17)7-12(11)15;/h2-8H,18H2,1H3;1H.
What are the key properties of 1-[4-(2,4,5-trifluorophenyl)phenyl]ethanamine;hydrochloride?
1-[4-(2,4,5-trifluorophenyl)phenyl]ethanamine;hydrochloride has a molecular weight of 287.71 g/mol, XLogP of 4.21, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[4-(2,4,5-trifluorophenyl)phenyl]ethanamine;hydrochloride is sourced from PubChem (CID 168665288), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).