C19H12BrF3N6 — CID 168665549
3-[(4-bromophenyl)diazenyl]-5-phenyl-7-(trifluoromethyl)pyrazolo[1,5-a]pyrimidin-2-amine (PubChem CID 168665549) has the molecular formula C19H12BrF3N6 and a molecular weight of 461.25 g/mol. Its IUPAC name is 3-[(4-bromophenyl)diazenyl]-5-phenyl-7-(trifluoromethyl)pyrazolo[1,5-a]pyrimidin-2-amine.
| Compound Name | 3-[(4-bromophenyl)diazenyl]-5-phenyl-7-(trifluoromethyl)pyrazolo[1,5-a]pyrimidin-2-amine |
|---|---|
| PubChem CID | 168665549 |
| Molecular Formula | C19H12BrF3N6 |
| Molecular Weight | 461.25 g/mol |
| Exact Mass | 460.03 |
| IUPAC Name | 3-[(4-bromophenyl)diazenyl]-5-phenyl-7-(trifluoromethyl)pyrazolo[1,5-a]pyrimidin-2-amine |
| SMILES | Nc1nn2c(C(F)(F)F)cc(-c3ccccc3)nc2c1/N=N/c1ccc(Br)cc1 |
| InChI | InChI=1S/C19H12BrF3N6/c20-12-6-8-13(9-7-12)26-27-16-17(24)28-29-15(19(21,22)23)10-14(25-18(16)29)11-4-2-1-3-5-11/h1-10H,(H2,24,28)/b27-26+ |
| InChIKey | VHBNAIPBFYZVJD-CYYJNZCTSA-N |
| XLogP | 6.18 |
| TPSA | 80.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.25 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|