About N-[[6-bromo-3-(3,3-difluoropyrrolidin-1-yl)-2-pyridinyl]methyl]-N-ethylethanamine
N-[[6-bromo-3-(3,3-difluoropyrrolidin-1-yl)-2-pyridinyl]methyl]-N-ethylethanamine (PubChem CID 168665689) has the molecular formula C14H20BrF2N3
and a molecular weight of 348.24 g/mol. Its IUPAC name is N-[[6-bromo-3-(3,3-difluoropyrrolidin-1-yl)-2-pyridinyl]methyl]-N-ethylethanamine.
Molecular Properties
| Compound Name | N-[[6-bromo-3-(3,3-difluoropyrrolidin-1-yl)-2-pyridinyl]methyl]-N-ethylethanamine |
| PubChem CID | 168665689 |
| Molecular Formula | C14H20BrF2N3 |
| Molecular Weight | 348.24 g/mol |
| Exact Mass | 347.08 |
| IUPAC Name | N-[[6-bromo-3-(3,3-difluoropyrrolidin-1-yl)-2-pyridinyl]methyl]-N-ethylethanamine |
| SMILES | CCN(CC)Cc1nc(Br)ccc1N1CCC(F)(F)C1 |
| InChI | InChI=1S/C14H20BrF2N3/c1-3-19(4-2)9-11-12(5-6-13(15)18-11)20-8-7-14(16,17)10-20/h5-6H,3-4,7-10H2,1-2H3 |
| InChIKey | DZNZDMDYASPILQ-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 19.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 348.24 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze N-[[6-bromo-3-(3,3-difluoropyrrolidin-1-yl)-2-pyridinyl]methyl]-N-ethylethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[[6-bromo-3-(3,3-difluoropyrrolidin-1-yl)-2-pyridinyl]methyl]-N-ethylethanamine?
The IUPAC name of N-[[6-bromo-3-(3,3-difluoropyrrolidin-1-yl)-2-pyridinyl]methyl]-N-ethylethanamine (CID 168665689) is N-[[6-bromo-3-(3,3-difluoropyrrolidin-1-yl)-2-pyridinyl]methyl]-N-ethylethanamine.
What is the SMILES notation for N-[[6-bromo-3-(3,3-difluoropyrrolidin-1-yl)-2-pyridinyl]methyl]-N-ethylethanamine?
The canonical SMILES for N-[[6-bromo-3-(3,3-difluoropyrrolidin-1-yl)-2-pyridinyl]methyl]-N-ethylethanamine is CCN(CC)Cc1nc(Br)ccc1N1CCC(F)(F)C1.
What is the InChIKey of N-[[6-bromo-3-(3,3-difluoropyrrolidin-1-yl)-2-pyridinyl]methyl]-N-ethylethanamine?
The InChIKey is DZNZDMDYASPILQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20BrF2N3/c1-3-19(4-2)9-11-12(5-6-13(15)18-11)20-8-7-14(16,17)10-20/h5-6H,3-4,7-10H2,1-2H3.
What are the key properties of N-[[6-bromo-3-(3,3-difluoropyrrolidin-1-yl)-2-pyridinyl]methyl]-N-ethylethanamine?
N-[[6-bromo-3-(3,3-difluoropyrrolidin-1-yl)-2-pyridinyl]methyl]-N-ethylethanamine has a molecular weight of 348.24 g/mol, XLogP of 3.53, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[[6-bromo-3-(3,3-difluoropyrrolidin-1-yl)-2-pyridinyl]methyl]-N-ethylethanamine is sourced from PubChem (CID 168665689), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).