C14H21NO6S — CID 168665984
(2S)-2-[4-(acetylsulfanylmethyl)-2-oxopyrrolidin-1-yl]-5-ethoxy-5-oxopentanoic acid (PubChem CID 168665984) has the molecular formula C14H21NO6S and a molecular weight of 331.39 g/mol. Its IUPAC name is (2S)-2-[4-(acetylsulfanylmethyl)-2-oxopyrrolidin-1-yl]-5-ethoxy-5-oxopentanoic acid.
| Compound Name | (2S)-2-[4-(acetylsulfanylmethyl)-2-oxopyrrolidin-1-yl]-5-ethoxy-5-oxopentanoic acid |
|---|---|
| PubChem CID | 168665984 |
| Molecular Formula | C14H21NO6S |
| Molecular Weight | 331.39 g/mol |
| Exact Mass | 331.11 |
| IUPAC Name | (2S)-2-[4-(acetylsulfanylmethyl)-2-oxopyrrolidin-1-yl]-5-ethoxy-5-oxopentanoic acid |
| SMILES | CCOC(=O)CC[C@@H](C(=O)O)N1CC(CSC(C)=O)CC1=O |
| InChI | InChI=1S/C14H21NO6S/c1-3-21-13(18)5-4-11(14(19)20)15-7-10(6-12(15)17)8-22-9(2)16/h10-11H,3-8H2,1-2H3,(H,19,20)/t10?,11-/m0/s1 |
| InChIKey | NQDFRTMOWNIGNQ-DTIOYNMSSA-N |
| XLogP | 0.91 |
| TPSA | 100.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.39 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|