C15H15F4NO2S — CID 168667718
S-[[1-[[2-fluoro-6-(trifluoromethyl)phenyl]methyl]-5-oxopyrrolidin-3-yl]methyl] ethanethioate (PubChem CID 168667718) has the molecular formula C15H15F4NO2S and a molecular weight of 349.35 g/mol. Its IUPAC name is S-[[1-[[2-fluoro-6-(trifluoromethyl)phenyl]methyl]-5-oxopyrrolidin-3-yl]methyl] ethanethioate.
| Compound Name | S-[[1-[[2-fluoro-6-(trifluoromethyl)phenyl]methyl]-5-oxopyrrolidin-3-yl]methyl] ethanethioate |
|---|---|
| PubChem CID | 168667718 |
| Molecular Formula | C15H15F4NO2S |
| Molecular Weight | 349.35 g/mol |
| Exact Mass | 349.08 |
| IUPAC Name | S-[[1-[[2-fluoro-6-(trifluoromethyl)phenyl]methyl]-5-oxopyrrolidin-3-yl]methyl] ethanethioate |
| SMILES | CC(=O)SCC1CC(=O)N(Cc2c(F)cccc2C(F)(F)F)C1 |
| InChI | InChI=1S/C15H15F4NO2S/c1-9(21)23-8-10-5-14(22)20(6-10)7-11-12(15(17,18)19)3-2-4-13(11)16/h2-4,10H,5-8H2,1H3 |
| InChIKey | LTCYTSKXRNOFAD-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.35 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|