C15H17N3O2S — CID 168667793
S-[[5-oxo-1-(1H-pyrrolo[2,3-b]pyridin-3-ylmethyl)pyrrolidin-3-yl]methyl] ethanethioate (PubChem CID 168667793) has the molecular formula C15H17N3O2S and a molecular weight of 303.39 g/mol. Its IUPAC name is S-[[5-oxo-1-(1H-pyrrolo[2,3-b]pyridin-3-ylmethyl)pyrrolidin-3-yl]methyl] ethanethioate.
| Compound Name | S-[[5-oxo-1-(1H-pyrrolo[2,3-b]pyridin-3-ylmethyl)pyrrolidin-3-yl]methyl] ethanethioate |
|---|---|
| PubChem CID | 168667793 |
| Molecular Formula | C15H17N3O2S |
| Molecular Weight | 303.39 g/mol |
| Exact Mass | 303.10 |
| IUPAC Name | S-[[5-oxo-1-(1H-pyrrolo[2,3-b]pyridin-3-ylmethyl)pyrrolidin-3-yl]methyl] ethanethioate |
| SMILES | CC(=O)SCC1CC(=O)N(Cc2c[nH]c3ncccc23)C1 |
| InChI | InChI=1S/C15H17N3O2S/c1-10(19)21-9-11-5-14(20)18(7-11)8-12-6-17-15-13(12)3-2-4-16-15/h2-4,6,11H,5,7-9H2,1H3,(H,16,17) |
| InChIKey | CTJOPTMTTRVXCV-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 66.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.39 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|