About S-[[1-(1,2-oxazol-3-ylmethyl)-5-oxopyrrolidin-3-yl]methyl] ethanethioate
S-[[1-(1,2-oxazol-3-ylmethyl)-5-oxopyrrolidin-3-yl]methyl] ethanethioate (PubChem CID 168667872) has the molecular formula C11H14N2O3S
and a molecular weight of 254.31 g/mol. Its IUPAC name is S-[[1-(1,2-oxazol-3-ylmethyl)-5-oxopyrrolidin-3-yl]methyl] ethanethioate.
Molecular Properties
| Compound Name | S-[[1-(1,2-oxazol-3-ylmethyl)-5-oxopyrrolidin-3-yl]methyl] ethanethioate |
| PubChem CID | 168667872 |
| Molecular Formula | C11H14N2O3S |
| Molecular Weight | 254.31 g/mol |
| Exact Mass | 254.07 |
| IUPAC Name | S-[[1-(1,2-oxazol-3-ylmethyl)-5-oxopyrrolidin-3-yl]methyl] ethanethioate |
| SMILES | CC(=O)SCC1CC(=O)N(Cc2ccon2)C1 |
| InChI | InChI=1S/C11H14N2O3S/c1-8(14)17-7-9-4-11(15)13(5-9)6-10-2-3-16-12-10/h2-3,9H,4-7H2,1H3 |
| InChIKey | WLFIARWBKARCSQ-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 63.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.31 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-[[1-(1,2-oxazol-3-ylmethyl)-5-oxopyrrolidin-3-yl]methyl] ethanethioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-[[1-(1,2-oxazol-3-ylmethyl)-5-oxopyrrolidin-3-yl]methyl] ethanethioate?
The IUPAC name of S-[[1-(1,2-oxazol-3-ylmethyl)-5-oxopyrrolidin-3-yl]methyl] ethanethioate (CID 168667872) is S-[[1-(1,2-oxazol-3-ylmethyl)-5-oxopyrrolidin-3-yl]methyl] ethanethioate.
What is the SMILES notation for S-[[1-(1,2-oxazol-3-ylmethyl)-5-oxopyrrolidin-3-yl]methyl] ethanethioate?
The canonical SMILES for S-[[1-(1,2-oxazol-3-ylmethyl)-5-oxopyrrolidin-3-yl]methyl] ethanethioate is CC(=O)SCC1CC(=O)N(Cc2ccon2)C1.
What is the InChIKey of S-[[1-(1,2-oxazol-3-ylmethyl)-5-oxopyrrolidin-3-yl]methyl] ethanethioate?
The InChIKey is WLFIARWBKARCSQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14N2O3S/c1-8(14)17-7-9-4-11(15)13(5-9)6-10-2-3-16-12-10/h2-3,9H,4-7H2,1H3.
What are the key properties of S-[[1-(1,2-oxazol-3-ylmethyl)-5-oxopyrrolidin-3-yl]methyl] ethanethioate?
S-[[1-(1,2-oxazol-3-ylmethyl)-5-oxopyrrolidin-3-yl]methyl] ethanethioate has a molecular weight of 254.31 g/mol, XLogP of 1.30, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for S-[[1-(1,2-oxazol-3-ylmethyl)-5-oxopyrrolidin-3-yl]methyl] ethanethioate is sourced from PubChem (CID 168667872), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).