C12H15NO3S2 — CID 168669845
ethyl 2-[2-oxo-4-(sulfanylmethyl)pyrrolidin-1-yl]thiophene-3-carboxylate (PubChem CID 168669845) has the molecular formula C12H15NO3S2 and a molecular weight of 285.39 g/mol. Its IUPAC name is ethyl 2-[2-oxo-4-(sulfanylmethyl)pyrrolidin-1-yl]thiophene-3-carboxylate.
| Compound Name | ethyl 2-[2-oxo-4-(sulfanylmethyl)pyrrolidin-1-yl]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 168669845 |
| Molecular Formula | C12H15NO3S2 |
| Molecular Weight | 285.39 g/mol |
| Exact Mass | 285.05 |
| IUPAC Name | ethyl 2-[2-oxo-4-(sulfanylmethyl)pyrrolidin-1-yl]thiophene-3-carboxylate |
| SMILES | CCOC(=O)c1ccsc1N1CC(CS)CC1=O |
| InChI | InChI=1S/C12H15NO3S2/c1-2-16-12(15)9-3-4-18-11(9)13-6-8(7-17)5-10(13)14/h3-4,8,17H,2,5-7H2,1H3 |
| InChIKey | GAWAPWQKIBOKSG-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 46.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.39 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|