About 1-[2-(1,3-oxazol-5-yl)ethyl]-4-(sulfanylmethyl)pyrrolidin-2-one
1-[2-(1,3-oxazol-5-yl)ethyl]-4-(sulfanylmethyl)pyrrolidin-2-one (PubChem CID 168671023) has the molecular formula C10H14N2O2S
and a molecular weight of 226.30 g/mol. Its IUPAC name is 1-[2-(1,3-oxazol-5-yl)ethyl]-4-(sulfanylmethyl)pyrrolidin-2-one.
Molecular Properties
| Compound Name | 1-[2-(1,3-oxazol-5-yl)ethyl]-4-(sulfanylmethyl)pyrrolidin-2-one |
| PubChem CID | 168671023 |
| Molecular Formula | C10H14N2O2S |
| Molecular Weight | 226.30 g/mol |
| Exact Mass | 226.08 |
| IUPAC Name | 1-[2-(1,3-oxazol-5-yl)ethyl]-4-(sulfanylmethyl)pyrrolidin-2-one |
| SMILES | O=C1CC(CS)CN1CCc1cnco1 |
| InChI | InChI=1S/C10H14N2O2S/c13-10-3-8(6-15)5-12(10)2-1-9-4-11-7-14-9/h4,7-8,15H,1-3,5-6H2 |
| InChIKey | KJZKYVTXBGJFET-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 46.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.30 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 1-[2-(1,3-oxazol-5-yl)ethyl]-4-(sulfanylmethyl)pyrrolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2-(1,3-oxazol-5-yl)ethyl]-4-(sulfanylmethyl)pyrrolidin-2-one?
The IUPAC name of 1-[2-(1,3-oxazol-5-yl)ethyl]-4-(sulfanylmethyl)pyrrolidin-2-one (CID 168671023) is 1-[2-(1,3-oxazol-5-yl)ethyl]-4-(sulfanylmethyl)pyrrolidin-2-one.
What is the SMILES notation for 1-[2-(1,3-oxazol-5-yl)ethyl]-4-(sulfanylmethyl)pyrrolidin-2-one?
The canonical SMILES for 1-[2-(1,3-oxazol-5-yl)ethyl]-4-(sulfanylmethyl)pyrrolidin-2-one is O=C1CC(CS)CN1CCc1cnco1.
What is the InChIKey of 1-[2-(1,3-oxazol-5-yl)ethyl]-4-(sulfanylmethyl)pyrrolidin-2-one?
The InChIKey is KJZKYVTXBGJFET-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14N2O2S/c13-10-3-8(6-15)5-12(10)2-1-9-4-11-7-14-9/h4,7-8,15H,1-3,5-6H2.
What are the key properties of 1-[2-(1,3-oxazol-5-yl)ethyl]-4-(sulfanylmethyl)pyrrolidin-2-one?
1-[2-(1,3-oxazol-5-yl)ethyl]-4-(sulfanylmethyl)pyrrolidin-2-one has a molecular weight of 226.30 g/mol, XLogP of 1.00, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2-(1,3-oxazol-5-yl)ethyl]-4-(sulfanylmethyl)pyrrolidin-2-one is sourced from PubChem (CID 168671023), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).