C12H13Br2NOS — CID 168671055
1-[(2,5-dibromophenyl)methyl]-4-(sulfanylmethyl)pyrrolidin-2-one (PubChem CID 168671055) has the molecular formula C12H13Br2NOS and a molecular weight of 379.12 g/mol. Its IUPAC name is 1-[(2,5-dibromophenyl)methyl]-4-(sulfanylmethyl)pyrrolidin-2-one.
| Compound Name | 1-[(2,5-dibromophenyl)methyl]-4-(sulfanylmethyl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 168671055 |
| Molecular Formula | C12H13Br2NOS |
| Molecular Weight | 379.12 g/mol |
| Exact Mass | 376.91 |
| IUPAC Name | 1-[(2,5-dibromophenyl)methyl]-4-(sulfanylmethyl)pyrrolidin-2-one |
| SMILES | O=C1CC(CS)CN1Cc1cc(Br)ccc1Br |
| InChI | InChI=1S/C12H13Br2NOS/c13-10-1-2-11(14)9(4-10)6-15-5-8(7-17)3-12(15)16/h1-2,4,8,17H,3,5-7H2 |
| InChIKey | KXJDAWTUVFEIKF-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 20.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.12 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|