C8H11N3OS — CID 168671956
1-(1H-pyrazol-4-yl)-4-(sulfanylmethyl)pyrrolidin-2-one (PubChem CID 168671956) has the molecular formula C8H11N3OS and a molecular weight of 197.26 g/mol. Its IUPAC name is 1-(1H-pyrazol-4-yl)-4-(sulfanylmethyl)pyrrolidin-2-one.
| Compound Name | 1-(1H-pyrazol-4-yl)-4-(sulfanylmethyl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 168671956 |
| Molecular Formula | C8H11N3OS |
| Molecular Weight | 197.26 g/mol |
| Exact Mass | 197.06 |
| IUPAC Name | 1-(1H-pyrazol-4-yl)-4-(sulfanylmethyl)pyrrolidin-2-one |
| SMILES | O=C1CC(CS)CN1c1cn[nH]c1 |
| InChI | InChI=1S/C8H11N3OS/c12-8-1-6(5-13)4-11(8)7-2-9-10-3-7/h2-3,6,13H,1,4-5H2,(H,9,10) |
| InChIKey | ILTFNOUFULFBTD-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 48.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.26 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|