About [1-(2,2-dimethyl-1,3-dioxan-5-yl)-5-oxopyrrolidin-3-yl]methanesulfonyl chloride
[1-(2,2-dimethyl-1,3-dioxan-5-yl)-5-oxopyrrolidin-3-yl]methanesulfonyl chloride (PubChem CID 168672673) has the molecular formula C11H18ClNO5S
and a molecular weight of 311.79 g/mol. Its IUPAC name is [1-(2,2-dimethyl-1,3-dioxan-5-yl)-5-oxopyrrolidin-3-yl]methanesulfonyl chloride.
Molecular Properties
| Compound Name | [1-(2,2-dimethyl-1,3-dioxan-5-yl)-5-oxopyrrolidin-3-yl]methanesulfonyl chloride |
| PubChem CID | 168672673 |
| Molecular Formula | C11H18ClNO5S |
| Molecular Weight | 311.79 g/mol |
| Exact Mass | 311.06 |
| IUPAC Name | [1-(2,2-dimethyl-1,3-dioxan-5-yl)-5-oxopyrrolidin-3-yl]methanesulfonyl chloride |
| SMILES | CC1(C)OCC(N2CC(CS(=O)(=O)Cl)CC2=O)CO1 |
| InChI | InChI=1S/C11H18ClNO5S/c1-11(2)17-5-9(6-18-11)13-4-8(3-10(13)14)7-19(12,15)16/h8-9H,3-7H2,1-2H3 |
| InChIKey | SRDUJEBWOCKYSW-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 311.79 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [1-(2,2-dimethyl-1,3-dioxan-5-yl)-5-oxopyrrolidin-3-yl]methanesulfonyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-(2,2-dimethyl-1,3-dioxan-5-yl)-5-oxopyrrolidin-3-yl]methanesulfonyl chloride?
The IUPAC name of [1-(2,2-dimethyl-1,3-dioxan-5-yl)-5-oxopyrrolidin-3-yl]methanesulfonyl chloride (CID 168672673) is [1-(2,2-dimethyl-1,3-dioxan-5-yl)-5-oxopyrrolidin-3-yl]methanesulfonyl chloride.
What is the SMILES notation for [1-(2,2-dimethyl-1,3-dioxan-5-yl)-5-oxopyrrolidin-3-yl]methanesulfonyl chloride?
The canonical SMILES for [1-(2,2-dimethyl-1,3-dioxan-5-yl)-5-oxopyrrolidin-3-yl]methanesulfonyl chloride is CC1(C)OCC(N2CC(CS(=O)(=O)Cl)CC2=O)CO1.
What is the InChIKey of [1-(2,2-dimethyl-1,3-dioxan-5-yl)-5-oxopyrrolidin-3-yl]methanesulfonyl chloride?
The InChIKey is SRDUJEBWOCKYSW-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18ClNO5S/c1-11(2)17-5-9(6-18-11)13-4-8(3-10(13)14)7-19(12,15)16/h8-9H,3-7H2,1-2H3.
What are the key properties of [1-(2,2-dimethyl-1,3-dioxan-5-yl)-5-oxopyrrolidin-3-yl]methanesulfonyl chloride?
[1-(2,2-dimethyl-1,3-dioxan-5-yl)-5-oxopyrrolidin-3-yl]methanesulfonyl chloride has a molecular weight of 311.79 g/mol, XLogP of 0.56, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [1-(2,2-dimethyl-1,3-dioxan-5-yl)-5-oxopyrrolidin-3-yl]methanesulfonyl chloride is sourced from PubChem (CID 168672673), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).