About [1-(2,2-difluoroethyl)-5-oxopyrrolidin-3-yl]methanesulfonyl chloride
[1-(2,2-difluoroethyl)-5-oxopyrrolidin-3-yl]methanesulfonyl chloride (PubChem CID 168673630) has the molecular formula C7H10ClF2NO3S
and a molecular weight of 261.68 g/mol. Its IUPAC name is [1-(2,2-difluoroethyl)-5-oxopyrrolidin-3-yl]methanesulfonyl chloride.
Molecular Properties
| Compound Name | [1-(2,2-difluoroethyl)-5-oxopyrrolidin-3-yl]methanesulfonyl chloride |
| PubChem CID | 168673630 |
| Molecular Formula | C7H10ClF2NO3S |
| Molecular Weight | 261.68 g/mol |
| Exact Mass | 261.00 |
| IUPAC Name | [1-(2,2-difluoroethyl)-5-oxopyrrolidin-3-yl]methanesulfonyl chloride |
| SMILES | O=C1CC(CS(=O)(=O)Cl)CN1CC(F)F |
| InChI | InChI=1S/C7H10ClF2NO3S/c8-15(13,14)4-5-1-7(12)11(2-5)3-6(9)10/h5-6H,1-4H2 |
| InChIKey | WKWLQCKIFBVAMV-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.68 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [1-(2,2-difluoroethyl)-5-oxopyrrolidin-3-yl]methanesulfonyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-(2,2-difluoroethyl)-5-oxopyrrolidin-3-yl]methanesulfonyl chloride?
The IUPAC name of [1-(2,2-difluoroethyl)-5-oxopyrrolidin-3-yl]methanesulfonyl chloride (CID 168673630) is [1-(2,2-difluoroethyl)-5-oxopyrrolidin-3-yl]methanesulfonyl chloride.
What is the SMILES notation for [1-(2,2-difluoroethyl)-5-oxopyrrolidin-3-yl]methanesulfonyl chloride?
The canonical SMILES for [1-(2,2-difluoroethyl)-5-oxopyrrolidin-3-yl]methanesulfonyl chloride is O=C1CC(CS(=O)(=O)Cl)CN1CC(F)F.
What is the InChIKey of [1-(2,2-difluoroethyl)-5-oxopyrrolidin-3-yl]methanesulfonyl chloride?
The InChIKey is WKWLQCKIFBVAMV-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10ClF2NO3S/c8-15(13,14)4-5-1-7(12)11(2-5)3-6(9)10/h5-6H,1-4H2.
What are the key properties of [1-(2,2-difluoroethyl)-5-oxopyrrolidin-3-yl]methanesulfonyl chloride?
[1-(2,2-difluoroethyl)-5-oxopyrrolidin-3-yl]methanesulfonyl chloride has a molecular weight of 261.68 g/mol, XLogP of 0.67, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [1-(2,2-difluoroethyl)-5-oxopyrrolidin-3-yl]methanesulfonyl chloride is sourced from PubChem (CID 168673630), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).