C10H9ClF3N3O3S — CID 168674566
[5-oxo-1-[4-(trifluoromethyl)pyrimidin-2-yl]pyrrolidin-3-yl]methanesulfonyl chloride (PubChem CID 168674566) has the molecular formula C10H9ClF3N3O3S and a molecular weight of 343.71 g/mol. Its IUPAC name is [5-oxo-1-[4-(trifluoromethyl)pyrimidin-2-yl]pyrrolidin-3-yl]methanesulfonyl chloride.
| Compound Name | [5-oxo-1-[4-(trifluoromethyl)pyrimidin-2-yl]pyrrolidin-3-yl]methanesulfonyl chloride |
|---|---|
| PubChem CID | 168674566 |
| Molecular Formula | C10H9ClF3N3O3S |
| Molecular Weight | 343.71 g/mol |
| Exact Mass | 343.00 |
| IUPAC Name | [5-oxo-1-[4-(trifluoromethyl)pyrimidin-2-yl]pyrrolidin-3-yl]methanesulfonyl chloride |
| SMILES | O=C1CC(CS(=O)(=O)Cl)CN1c1nccc(C(F)(F)F)n1 |
| InChI | InChI=1S/C10H9ClF3N3O3S/c11-21(19,20)5-6-3-8(18)17(4-6)9-15-2-1-7(16-9)10(12,13)14/h1-2,6H,3-5H2 |
| InChIKey | LYPSPMVYPLCEPL-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 80.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.71 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |