About [1-[(5-amino-1,3,3-trimethylcyclohexyl)methyl]-5-oxopyrrolidin-3-yl]methanesulfonyl fluoride
[1-[(5-amino-1,3,3-trimethylcyclohexyl)methyl]-5-oxopyrrolidin-3-yl]methanesulfonyl fluoride (PubChem CID 168674623) has the molecular formula C15H27FN2O3S
and a molecular weight of 334.46 g/mol. Its IUPAC name is [1-[(5-amino-1,3,3-trimethylcyclohexyl)methyl]-5-oxopyrrolidin-3-yl]methanesulfonyl fluoride.
Molecular Properties
| Compound Name | [1-[(5-amino-1,3,3-trimethylcyclohexyl)methyl]-5-oxopyrrolidin-3-yl]methanesulfonyl fluoride |
| PubChem CID | 168674623 |
| Molecular Formula | C15H27FN2O3S |
| Molecular Weight | 334.46 g/mol |
| Exact Mass | 334.17 |
| IUPAC Name | [1-[(5-amino-1,3,3-trimethylcyclohexyl)methyl]-5-oxopyrrolidin-3-yl]methanesulfonyl fluoride |
| SMILES | CC1(C)CC(N)CC(C)(CN2CC(CS(=O)(=O)F)CC2=O)C1 |
| InChI | InChI=1S/C15H27FN2O3S/c1-14(2)5-12(17)6-15(3,9-14)10-18-7-11(4-13(18)19)8-22(16,20)21/h11-12H,4-10,17H2,1-3H3 |
| InChIKey | GBUFUKKZAWPRKI-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 80.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 334.46 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [1-[(5-amino-1,3,3-trimethylcyclohexyl)methyl]-5-oxopyrrolidin-3-yl]methanesulfonyl fluoride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-[(5-amino-1,3,3-trimethylcyclohexyl)methyl]-5-oxopyrrolidin-3-yl]methanesulfonyl fluoride?
The IUPAC name of [1-[(5-amino-1,3,3-trimethylcyclohexyl)methyl]-5-oxopyrrolidin-3-yl]methanesulfonyl fluoride (CID 168674623) is [1-[(5-amino-1,3,3-trimethylcyclohexyl)methyl]-5-oxopyrrolidin-3-yl]methanesulfonyl fluoride.
What is the SMILES notation for [1-[(5-amino-1,3,3-trimethylcyclohexyl)methyl]-5-oxopyrrolidin-3-yl]methanesulfonyl fluoride?
The canonical SMILES for [1-[(5-amino-1,3,3-trimethylcyclohexyl)methyl]-5-oxopyrrolidin-3-yl]methanesulfonyl fluoride is CC1(C)CC(N)CC(C)(CN2CC(CS(=O)(=O)F)CC2=O)C1.
What is the InChIKey of [1-[(5-amino-1,3,3-trimethylcyclohexyl)methyl]-5-oxopyrrolidin-3-yl]methanesulfonyl fluoride?
The InChIKey is GBUFUKKZAWPRKI-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H27FN2O3S/c1-14(2)5-12(17)6-15(3,9-14)10-18-7-11(4-13(18)19)8-22(16,20)21/h11-12H,4-10,17H2,1-3H3.
What are the key properties of [1-[(5-amino-1,3,3-trimethylcyclohexyl)methyl]-5-oxopyrrolidin-3-yl]methanesulfonyl fluoride?
[1-[(5-amino-1,3,3-trimethylcyclohexyl)methyl]-5-oxopyrrolidin-3-yl]methanesulfonyl fluoride has a molecular weight of 334.46 g/mol, XLogP of 1.68, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [1-[(5-amino-1,3,3-trimethylcyclohexyl)methyl]-5-oxopyrrolidin-3-yl]methanesulfonyl fluoride is sourced from PubChem (CID 168674623), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).