About [1-[2-(3,5-dimethylpiperidin-1-yl)ethyl]-5-oxopyrrolidin-3-yl]methanesulfonyl fluoride
[1-[2-(3,5-dimethylpiperidin-1-yl)ethyl]-5-oxopyrrolidin-3-yl]methanesulfonyl fluoride (PubChem CID 168674626) has the molecular formula C14H25FN2O3S
and a molecular weight of 320.43 g/mol. Its IUPAC name is [1-[2-(3,5-dimethylpiperidin-1-yl)ethyl]-5-oxopyrrolidin-3-yl]methanesulfonyl fluoride.
Molecular Properties
| Compound Name | [1-[2-(3,5-dimethylpiperidin-1-yl)ethyl]-5-oxopyrrolidin-3-yl]methanesulfonyl fluoride |
| PubChem CID | 168674626 |
| Molecular Formula | C14H25FN2O3S |
| Molecular Weight | 320.43 g/mol |
| Exact Mass | 320.16 |
| IUPAC Name | [1-[2-(3,5-dimethylpiperidin-1-yl)ethyl]-5-oxopyrrolidin-3-yl]methanesulfonyl fluoride |
| SMILES | CC1CC(C)CN(CCN2CC(CS(=O)(=O)F)CC2=O)C1 |
| InChI | InChI=1S/C14H25FN2O3S/c1-11-5-12(2)8-16(7-11)3-4-17-9-13(6-14(17)18)10-21(15,19)20/h11-13H,3-10H2,1-2H3 |
| InChIKey | DOOUXTYZJGHQEH-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 320.43 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [1-[2-(3,5-dimethylpiperidin-1-yl)ethyl]-5-oxopyrrolidin-3-yl]methanesulfonyl fluoride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-[2-(3,5-dimethylpiperidin-1-yl)ethyl]-5-oxopyrrolidin-3-yl]methanesulfonyl fluoride?
The IUPAC name of [1-[2-(3,5-dimethylpiperidin-1-yl)ethyl]-5-oxopyrrolidin-3-yl]methanesulfonyl fluoride (CID 168674626) is [1-[2-(3,5-dimethylpiperidin-1-yl)ethyl]-5-oxopyrrolidin-3-yl]methanesulfonyl fluoride.
What is the SMILES notation for [1-[2-(3,5-dimethylpiperidin-1-yl)ethyl]-5-oxopyrrolidin-3-yl]methanesulfonyl fluoride?
The canonical SMILES for [1-[2-(3,5-dimethylpiperidin-1-yl)ethyl]-5-oxopyrrolidin-3-yl]methanesulfonyl fluoride is CC1CC(C)CN(CCN2CC(CS(=O)(=O)F)CC2=O)C1.
What is the InChIKey of [1-[2-(3,5-dimethylpiperidin-1-yl)ethyl]-5-oxopyrrolidin-3-yl]methanesulfonyl fluoride?
The InChIKey is DOOUXTYZJGHQEH-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H25FN2O3S/c1-11-5-12(2)8-16(7-11)3-4-17-9-13(6-14(17)18)10-21(15,19)20/h11-13H,3-10H2,1-2H3.
What are the key properties of [1-[2-(3,5-dimethylpiperidin-1-yl)ethyl]-5-oxopyrrolidin-3-yl]methanesulfonyl fluoride?
[1-[2-(3,5-dimethylpiperidin-1-yl)ethyl]-5-oxopyrrolidin-3-yl]methanesulfonyl fluoride has a molecular weight of 320.43 g/mol, XLogP of 1.11, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [1-[2-(3,5-dimethylpiperidin-1-yl)ethyl]-5-oxopyrrolidin-3-yl]methanesulfonyl fluoride is sourced from PubChem (CID 168674626), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).