About [1-[(2S,3S)-1-hydroxy-3-methylpentan-2-yl]-5-oxopyrrolidin-3-yl]methanesulfonyl fluoride
[1-[(2S,3S)-1-hydroxy-3-methylpentan-2-yl]-5-oxopyrrolidin-3-yl]methanesulfonyl fluoride (PubChem CID 168674630) has the molecular formula C11H20FNO4S
and a molecular weight of 281.35 g/mol. Its IUPAC name is [1-[(2S,3S)-1-hydroxy-3-methylpentan-2-yl]-5-oxopyrrolidin-3-yl]methanesulfonyl fluoride.
Molecular Properties
| Compound Name | [1-[(2S,3S)-1-hydroxy-3-methylpentan-2-yl]-5-oxopyrrolidin-3-yl]methanesulfonyl fluoride |
| PubChem CID | 168674630 |
| Molecular Formula | C11H20FNO4S |
| Molecular Weight | 281.35 g/mol |
| Exact Mass | 281.11 |
| IUPAC Name | [1-[(2S,3S)-1-hydroxy-3-methylpentan-2-yl]-5-oxopyrrolidin-3-yl]methanesulfonyl fluoride |
| SMILES | CC[C@H](C)[C@@H](CO)N1CC(CS(=O)(=O)F)CC1=O |
| InChI | InChI=1S/C11H20FNO4S/c1-3-8(2)10(6-14)13-5-9(4-11(13)15)7-18(12,16)17/h8-10,14H,3-7H2,1-2H3/t8-,9?,10+/m0/s1 |
| InChIKey | WSQNBALAEBPVCS-DJBFQZMMSA-N |
| XLogP | 0.54 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.35 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [1-[(2S,3S)-1-hydroxy-3-methylpentan-2-yl]-5-oxopyrrolidin-3-yl]methanesulfonyl fluoride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-[(2S,3S)-1-hydroxy-3-methylpentan-2-yl]-5-oxopyrrolidin-3-yl]methanesulfonyl fluoride?
The IUPAC name of [1-[(2S,3S)-1-hydroxy-3-methylpentan-2-yl]-5-oxopyrrolidin-3-yl]methanesulfonyl fluoride (CID 168674630) is [1-[(2S,3S)-1-hydroxy-3-methylpentan-2-yl]-5-oxopyrrolidin-3-yl]methanesulfonyl fluoride.
What is the SMILES notation for [1-[(2S,3S)-1-hydroxy-3-methylpentan-2-yl]-5-oxopyrrolidin-3-yl]methanesulfonyl fluoride?
The canonical SMILES for [1-[(2S,3S)-1-hydroxy-3-methylpentan-2-yl]-5-oxopyrrolidin-3-yl]methanesulfonyl fluoride is CC[C@H](C)[C@@H](CO)N1CC(CS(=O)(=O)F)CC1=O.
What is the InChIKey of [1-[(2S,3S)-1-hydroxy-3-methylpentan-2-yl]-5-oxopyrrolidin-3-yl]methanesulfonyl fluoride?
The InChIKey is WSQNBALAEBPVCS-DJBFQZMMSA-N. The full InChI is InChI=1S/C11H20FNO4S/c1-3-8(2)10(6-14)13-5-9(4-11(13)15)7-18(12,16)17/h8-10,14H,3-7H2,1-2H3/t8-,9?,10+/m0/s1.
What are the key properties of [1-[(2S,3S)-1-hydroxy-3-methylpentan-2-yl]-5-oxopyrrolidin-3-yl]methanesulfonyl fluoride?
[1-[(2S,3S)-1-hydroxy-3-methylpentan-2-yl]-5-oxopyrrolidin-3-yl]methanesulfonyl fluoride has a molecular weight of 281.35 g/mol, XLogP of 0.54, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [1-[(2S,3S)-1-hydroxy-3-methylpentan-2-yl]-5-oxopyrrolidin-3-yl]methanesulfonyl fluoride is sourced from PubChem (CID 168674630), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).