About [1-[(2R,3R)-1,3-dihydroxybutan-2-yl]-5-oxopyrrolidin-3-yl]methanesulfonyl fluoride
[1-[(2R,3R)-1,3-dihydroxybutan-2-yl]-5-oxopyrrolidin-3-yl]methanesulfonyl fluoride (PubChem CID 168674641) has the molecular formula C9H16FNO5S
and a molecular weight of 269.29 g/mol. Its IUPAC name is [1-[(2R,3R)-1,3-dihydroxybutan-2-yl]-5-oxopyrrolidin-3-yl]methanesulfonyl fluoride.
Molecular Properties
| Compound Name | [1-[(2R,3R)-1,3-dihydroxybutan-2-yl]-5-oxopyrrolidin-3-yl]methanesulfonyl fluoride |
| PubChem CID | 168674641 |
| Molecular Formula | C9H16FNO5S |
| Molecular Weight | 269.29 g/mol |
| Exact Mass | 269.07 |
| IUPAC Name | [1-[(2R,3R)-1,3-dihydroxybutan-2-yl]-5-oxopyrrolidin-3-yl]methanesulfonyl fluoride |
| SMILES | C[C@@H](O)[C@@H](CO)N1CC(CS(=O)(=O)F)CC1=O |
| InChI | InChI=1S/C9H16FNO5S/c1-6(13)8(4-12)11-3-7(2-9(11)14)5-17(10,15)16/h6-8,12-13H,2-5H2,1H3/t6-,7?,8-/m1/s1 |
| InChIKey | UHKJAALDHNFCIU-OECOWPMFSA-N |
| XLogP | -1.12 |
| TPSA | 94.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.29 |
| LogP ≤ 5 | -1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [1-[(2R,3R)-1,3-dihydroxybutan-2-yl]-5-oxopyrrolidin-3-yl]methanesulfonyl fluoride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-[(2R,3R)-1,3-dihydroxybutan-2-yl]-5-oxopyrrolidin-3-yl]methanesulfonyl fluoride?
The IUPAC name of [1-[(2R,3R)-1,3-dihydroxybutan-2-yl]-5-oxopyrrolidin-3-yl]methanesulfonyl fluoride (CID 168674641) is [1-[(2R,3R)-1,3-dihydroxybutan-2-yl]-5-oxopyrrolidin-3-yl]methanesulfonyl fluoride.
What is the SMILES notation for [1-[(2R,3R)-1,3-dihydroxybutan-2-yl]-5-oxopyrrolidin-3-yl]methanesulfonyl fluoride?
The canonical SMILES for [1-[(2R,3R)-1,3-dihydroxybutan-2-yl]-5-oxopyrrolidin-3-yl]methanesulfonyl fluoride is C[C@@H](O)[C@@H](CO)N1CC(CS(=O)(=O)F)CC1=O.
What is the InChIKey of [1-[(2R,3R)-1,3-dihydroxybutan-2-yl]-5-oxopyrrolidin-3-yl]methanesulfonyl fluoride?
The InChIKey is UHKJAALDHNFCIU-OECOWPMFSA-N. The full InChI is InChI=1S/C9H16FNO5S/c1-6(13)8(4-12)11-3-7(2-9(11)14)5-17(10,15)16/h6-8,12-13H,2-5H2,1H3/t6-,7?,8-/m1/s1.
What are the key properties of [1-[(2R,3R)-1,3-dihydroxybutan-2-yl]-5-oxopyrrolidin-3-yl]methanesulfonyl fluoride?
[1-[(2R,3R)-1,3-dihydroxybutan-2-yl]-5-oxopyrrolidin-3-yl]methanesulfonyl fluoride has a molecular weight of 269.29 g/mol, XLogP of -1.12, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [1-[(2R,3R)-1,3-dihydroxybutan-2-yl]-5-oxopyrrolidin-3-yl]methanesulfonyl fluoride is sourced from PubChem (CID 168674641), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).