About (2R)-2-cyclohexa-1,4-dien-1-yl-2-[4-(fluorosulfonylmethyl)-2-oxopyrrolidin-1-yl]acetic acid
(2R)-2-cyclohexa-1,4-dien-1-yl-2-[4-(fluorosulfonylmethyl)-2-oxopyrrolidin-1-yl]acetic acid (PubChem CID 168674976) has the molecular formula C13H16FNO5S
and a molecular weight of 317.34 g/mol. Its IUPAC name is (2R)-2-cyclohexa-1,4-dien-1-yl-2-[4-(fluorosulfonylmethyl)-2-oxopyrrolidin-1-yl]acetic acid.
Molecular Properties
| Compound Name | (2R)-2-cyclohexa-1,4-dien-1-yl-2-[4-(fluorosulfonylmethyl)-2-oxopyrrolidin-1-yl]acetic acid |
| PubChem CID | 168674976 |
| Molecular Formula | C13H16FNO5S |
| Molecular Weight | 317.34 g/mol |
| Exact Mass | 317.07 |
| IUPAC Name | (2R)-2-cyclohexa-1,4-dien-1-yl-2-[4-(fluorosulfonylmethyl)-2-oxopyrrolidin-1-yl]acetic acid |
| SMILES | O=C(O)[C@@H](C1=CCC=CC1)N1CC(CS(=O)(=O)F)CC1=O |
| InChI | InChI=1S/C13H16FNO5S/c14-21(19,20)8-9-6-11(16)15(7-9)12(13(17)18)10-4-2-1-3-5-10/h1-2,5,9,12H,3-4,6-8H2,(H,17,18)/t9?,12-/m1/s1 |
| InChIKey | LWQPICHZASGQPQ-FFFFSGIJSA-N |
| XLogP | 0.86 |
| TPSA | 91.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 317.34 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (2R)-2-cyclohexa-1,4-dien-1-yl-2-[4-(fluorosulfonylmethyl)-2-oxopyrrolidin-1-yl]acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-2-cyclohexa-1,4-dien-1-yl-2-[4-(fluorosulfonylmethyl)-2-oxopyrrolidin-1-yl]acetic acid?
The IUPAC name of (2R)-2-cyclohexa-1,4-dien-1-yl-2-[4-(fluorosulfonylmethyl)-2-oxopyrrolidin-1-yl]acetic acid (CID 168674976) is (2R)-2-cyclohexa-1,4-dien-1-yl-2-[4-(fluorosulfonylmethyl)-2-oxopyrrolidin-1-yl]acetic acid.
What is the SMILES notation for (2R)-2-cyclohexa-1,4-dien-1-yl-2-[4-(fluorosulfonylmethyl)-2-oxopyrrolidin-1-yl]acetic acid?
The canonical SMILES for (2R)-2-cyclohexa-1,4-dien-1-yl-2-[4-(fluorosulfonylmethyl)-2-oxopyrrolidin-1-yl]acetic acid is O=C(O)[C@@H](C1=CCC=CC1)N1CC(CS(=O)(=O)F)CC1=O.
What is the InChIKey of (2R)-2-cyclohexa-1,4-dien-1-yl-2-[4-(fluorosulfonylmethyl)-2-oxopyrrolidin-1-yl]acetic acid?
The InChIKey is LWQPICHZASGQPQ-FFFFSGIJSA-N. The full InChI is InChI=1S/C13H16FNO5S/c14-21(19,20)8-9-6-11(16)15(7-9)12(13(17)18)10-4-2-1-3-5-10/h1-2,5,9,12H,3-4,6-8H2,(H,17,18)/t9?,12-/m1/s1.
What are the key properties of (2R)-2-cyclohexa-1,4-dien-1-yl-2-[4-(fluorosulfonylmethyl)-2-oxopyrrolidin-1-yl]acetic acid?
(2R)-2-cyclohexa-1,4-dien-1-yl-2-[4-(fluorosulfonylmethyl)-2-oxopyrrolidin-1-yl]acetic acid has a molecular weight of 317.34 g/mol, XLogP of 0.86, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2-cyclohexa-1,4-dien-1-yl-2-[4-(fluorosulfonylmethyl)-2-oxopyrrolidin-1-yl]acetic acid is sourced from PubChem (CID 168674976), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).