About [5-oxo-1-(2,4,4-trimethylpentan-2-yl)pyrrolidin-3-yl]methanesulfonyl fluoride
[5-oxo-1-(2,4,4-trimethylpentan-2-yl)pyrrolidin-3-yl]methanesulfonyl fluoride (PubChem CID 168675042) has the molecular formula C13H24FNO3S
and a molecular weight of 293.40 g/mol. Its IUPAC name is [5-oxo-1-(2,4,4-trimethylpentan-2-yl)pyrrolidin-3-yl]methanesulfonyl fluoride.
Molecular Properties
| Compound Name | [5-oxo-1-(2,4,4-trimethylpentan-2-yl)pyrrolidin-3-yl]methanesulfonyl fluoride |
| PubChem CID | 168675042 |
| Molecular Formula | C13H24FNO3S |
| Molecular Weight | 293.40 g/mol |
| Exact Mass | 293.15 |
| IUPAC Name | [5-oxo-1-(2,4,4-trimethylpentan-2-yl)pyrrolidin-3-yl]methanesulfonyl fluoride |
| SMILES | CC(C)(C)CC(C)(C)N1CC(CS(=O)(=O)F)CC1=O |
| InChI | InChI=1S/C13H24FNO3S/c1-12(2,3)9-13(4,5)15-7-10(6-11(15)16)8-19(14,17)18/h10H,6-9H2,1-5H3 |
| InChIKey | ZAIUMDGPDJUQFZ-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 293.40 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [5-oxo-1-(2,4,4-trimethylpentan-2-yl)pyrrolidin-3-yl]methanesulfonyl fluoride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-oxo-1-(2,4,4-trimethylpentan-2-yl)pyrrolidin-3-yl]methanesulfonyl fluoride?
The IUPAC name of [5-oxo-1-(2,4,4-trimethylpentan-2-yl)pyrrolidin-3-yl]methanesulfonyl fluoride (CID 168675042) is [5-oxo-1-(2,4,4-trimethylpentan-2-yl)pyrrolidin-3-yl]methanesulfonyl fluoride.
What is the SMILES notation for [5-oxo-1-(2,4,4-trimethylpentan-2-yl)pyrrolidin-3-yl]methanesulfonyl fluoride?
The canonical SMILES for [5-oxo-1-(2,4,4-trimethylpentan-2-yl)pyrrolidin-3-yl]methanesulfonyl fluoride is CC(C)(C)CC(C)(C)N1CC(CS(=O)(=O)F)CC1=O.
What is the InChIKey of [5-oxo-1-(2,4,4-trimethylpentan-2-yl)pyrrolidin-3-yl]methanesulfonyl fluoride?
The InChIKey is ZAIUMDGPDJUQFZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H24FNO3S/c1-12(2,3)9-13(4,5)15-7-10(6-11(15)16)8-19(14,17)18/h10H,6-9H2,1-5H3.
What are the key properties of [5-oxo-1-(2,4,4-trimethylpentan-2-yl)pyrrolidin-3-yl]methanesulfonyl fluoride?
[5-oxo-1-(2,4,4-trimethylpentan-2-yl)pyrrolidin-3-yl]methanesulfonyl fluoride has a molecular weight of 293.40 g/mol, XLogP of 2.35, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [5-oxo-1-(2,4,4-trimethylpentan-2-yl)pyrrolidin-3-yl]methanesulfonyl fluoride is sourced from PubChem (CID 168675042), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).