C13H23FN2O5S — CID 168675049
tert-butyl N-[2-[4-(fluorosulfonylmethyl)-2-oxopyrrolidin-1-yl]ethyl]-N-methylcarbamate (PubChem CID 168675049) has the molecular formula C13H23FN2O5S and a molecular weight of 338.40 g/mol. Its IUPAC name is tert-butyl N-[2-[4-(fluorosulfonylmethyl)-2-oxopyrrolidin-1-yl]ethyl]-N-methylcarbamate.
| Compound Name | tert-butyl N-[2-[4-(fluorosulfonylmethyl)-2-oxopyrrolidin-1-yl]ethyl]-N-methylcarbamate |
|---|---|
| PubChem CID | 168675049 |
| Molecular Formula | C13H23FN2O5S |
| Molecular Weight | 338.40 g/mol |
| Exact Mass | 338.13 |
| IUPAC Name | tert-butyl N-[2-[4-(fluorosulfonylmethyl)-2-oxopyrrolidin-1-yl]ethyl]-N-methylcarbamate |
| SMILES | CN(CCN1CC(CS(=O)(=O)F)CC1=O)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C13H23FN2O5S/c1-13(2,3)21-12(18)15(4)5-6-16-8-10(7-11(16)17)9-22(14,19)20/h10H,5-9H2,1-4H3 |
| InChIKey | BXFQYVJNCGXIBJ-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 83.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.40 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |