About [1-[5-(hydroxymethyl)-2,2-dimethyl-1,3-dioxan-5-yl]-5-oxopyrrolidin-3-yl]methanesulfonyl fluoride
[1-[5-(hydroxymethyl)-2,2-dimethyl-1,3-dioxan-5-yl]-5-oxopyrrolidin-3-yl]methanesulfonyl fluoride (PubChem CID 168675147) has the molecular formula C12H20FNO6S
and a molecular weight of 325.36 g/mol. Its IUPAC name is [1-[5-(hydroxymethyl)-2,2-dimethyl-1,3-dioxan-5-yl]-5-oxopyrrolidin-3-yl]methanesulfonyl fluoride.
Molecular Properties
| Compound Name | [1-[5-(hydroxymethyl)-2,2-dimethyl-1,3-dioxan-5-yl]-5-oxopyrrolidin-3-yl]methanesulfonyl fluoride |
| PubChem CID | 168675147 |
| Molecular Formula | C12H20FNO6S |
| Molecular Weight | 325.36 g/mol |
| Exact Mass | 325.10 |
| IUPAC Name | [1-[5-(hydroxymethyl)-2,2-dimethyl-1,3-dioxan-5-yl]-5-oxopyrrolidin-3-yl]methanesulfonyl fluoride |
| SMILES | CC1(C)OCC(CO)(N2CC(CS(=O)(=O)F)CC2=O)CO1 |
| InChI | InChI=1S/C12H20FNO6S/c1-11(2)19-7-12(6-15,8-20-11)14-4-9(3-10(14)16)5-21(13,17)18/h9,15H,3-8H2,1-2H3 |
| InChIKey | WXIJZPIRNBBMTN-UHFFFAOYSA-N |
| XLogP | -0.35 |
| TPSA | 93.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 325.36 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [1-[5-(hydroxymethyl)-2,2-dimethyl-1,3-dioxan-5-yl]-5-oxopyrrolidin-3-yl]methanesulfonyl fluoride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-[5-(hydroxymethyl)-2,2-dimethyl-1,3-dioxan-5-yl]-5-oxopyrrolidin-3-yl]methanesulfonyl fluoride?
The IUPAC name of [1-[5-(hydroxymethyl)-2,2-dimethyl-1,3-dioxan-5-yl]-5-oxopyrrolidin-3-yl]methanesulfonyl fluoride (CID 168675147) is [1-[5-(hydroxymethyl)-2,2-dimethyl-1,3-dioxan-5-yl]-5-oxopyrrolidin-3-yl]methanesulfonyl fluoride.
What is the SMILES notation for [1-[5-(hydroxymethyl)-2,2-dimethyl-1,3-dioxan-5-yl]-5-oxopyrrolidin-3-yl]methanesulfonyl fluoride?
The canonical SMILES for [1-[5-(hydroxymethyl)-2,2-dimethyl-1,3-dioxan-5-yl]-5-oxopyrrolidin-3-yl]methanesulfonyl fluoride is CC1(C)OCC(CO)(N2CC(CS(=O)(=O)F)CC2=O)CO1.
What is the InChIKey of [1-[5-(hydroxymethyl)-2,2-dimethyl-1,3-dioxan-5-yl]-5-oxopyrrolidin-3-yl]methanesulfonyl fluoride?
The InChIKey is WXIJZPIRNBBMTN-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20FNO6S/c1-11(2)19-7-12(6-15,8-20-11)14-4-9(3-10(14)16)5-21(13,17)18/h9,15H,3-8H2,1-2H3.
What are the key properties of [1-[5-(hydroxymethyl)-2,2-dimethyl-1,3-dioxan-5-yl]-5-oxopyrrolidin-3-yl]methanesulfonyl fluoride?
[1-[5-(hydroxymethyl)-2,2-dimethyl-1,3-dioxan-5-yl]-5-oxopyrrolidin-3-yl]methanesulfonyl fluoride has a molecular weight of 325.36 g/mol, XLogP of -0.35, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [1-[5-(hydroxymethyl)-2,2-dimethyl-1,3-dioxan-5-yl]-5-oxopyrrolidin-3-yl]methanesulfonyl fluoride is sourced from PubChem (CID 168675147), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).