C15H10BrClN2O2S — CID 16867627
5-bromo-2-chloro-N-[(5-thiophen-2-yl-1,2-oxazol-3-yl)methyl]benzamide (PubChem CID 16867627) has the molecular formula C15H10BrClN2O2S and a molecular weight of 397.68 g/mol. Its IUPAC name is 5-bromo-2-chloro-N-[(5-thiophen-2-yl-1,2-oxazol-3-yl)methyl]benzamide.
| Compound Name | 5-bromo-2-chloro-N-[(5-thiophen-2-yl-1,2-oxazol-3-yl)methyl]benzamide |
|---|---|
| PubChem CID | 16867627 |
| Molecular Formula | C15H10BrClN2O2S |
| Molecular Weight | 397.68 g/mol |
| Exact Mass | 395.93 |
| IUPAC Name | 5-bromo-2-chloro-N-[(5-thiophen-2-yl-1,2-oxazol-3-yl)methyl]benzamide |
| SMILES | O=C(NCc1cc(-c2cccs2)on1)c1cc(Br)ccc1Cl |
| InChI | InChI=1S/C15H10BrClN2O2S/c16-9-3-4-12(17)11(6-9)15(20)18-8-10-7-13(21-19-10)14-2-1-5-22-14/h1-7H,8H2,(H,18,20) |
| InChIKey | KCXNDLXHUDBZQA-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.68 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |