About [1-(4-cyano-3-methyl-1,2-oxazol-5-yl)-5-oxopyrrolidin-3-yl]methanesulfonyl fluoride
[1-(4-cyano-3-methyl-1,2-oxazol-5-yl)-5-oxopyrrolidin-3-yl]methanesulfonyl fluoride (PubChem CID 168676283) has the molecular formula C10H10FN3O4S
and a molecular weight of 287.27 g/mol. Its IUPAC name is [1-(4-cyano-3-methyl-1,2-oxazol-5-yl)-5-oxopyrrolidin-3-yl]methanesulfonyl fluoride.
Molecular Properties
| Compound Name | [1-(4-cyano-3-methyl-1,2-oxazol-5-yl)-5-oxopyrrolidin-3-yl]methanesulfonyl fluoride |
| PubChem CID | 168676283 |
| Molecular Formula | C10H10FN3O4S |
| Molecular Weight | 287.27 g/mol |
| Exact Mass | 287.04 |
| IUPAC Name | [1-(4-cyano-3-methyl-1,2-oxazol-5-yl)-5-oxopyrrolidin-3-yl]methanesulfonyl fluoride |
| SMILES | Cc1noc(N2CC(CS(=O)(=O)F)CC2=O)c1C#N |
| InChI | InChI=1S/C10H10FN3O4S/c1-6-8(3-12)10(18-13-6)14-4-7(2-9(14)15)5-19(11,16)17/h7H,2,4-5H2,1H3 |
| InChIKey | VRPLQDVVMXPBDN-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 104.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.27 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [1-(4-cyano-3-methyl-1,2-oxazol-5-yl)-5-oxopyrrolidin-3-yl]methanesulfonyl fluoride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-(4-cyano-3-methyl-1,2-oxazol-5-yl)-5-oxopyrrolidin-3-yl]methanesulfonyl fluoride?
The IUPAC name of [1-(4-cyano-3-methyl-1,2-oxazol-5-yl)-5-oxopyrrolidin-3-yl]methanesulfonyl fluoride (CID 168676283) is [1-(4-cyano-3-methyl-1,2-oxazol-5-yl)-5-oxopyrrolidin-3-yl]methanesulfonyl fluoride.
What is the SMILES notation for [1-(4-cyano-3-methyl-1,2-oxazol-5-yl)-5-oxopyrrolidin-3-yl]methanesulfonyl fluoride?
The canonical SMILES for [1-(4-cyano-3-methyl-1,2-oxazol-5-yl)-5-oxopyrrolidin-3-yl]methanesulfonyl fluoride is Cc1noc(N2CC(CS(=O)(=O)F)CC2=O)c1C#N.
What is the InChIKey of [1-(4-cyano-3-methyl-1,2-oxazol-5-yl)-5-oxopyrrolidin-3-yl]methanesulfonyl fluoride?
The InChIKey is VRPLQDVVMXPBDN-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10FN3O4S/c1-6-8(3-12)10(18-13-6)14-4-7(2-9(14)15)5-19(11,16)17/h7H,2,4-5H2,1H3.
What are the key properties of [1-(4-cyano-3-methyl-1,2-oxazol-5-yl)-5-oxopyrrolidin-3-yl]methanesulfonyl fluoride?
[1-(4-cyano-3-methyl-1,2-oxazol-5-yl)-5-oxopyrrolidin-3-yl]methanesulfonyl fluoride has a molecular weight of 287.27 g/mol, XLogP of 0.51, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [1-(4-cyano-3-methyl-1,2-oxazol-5-yl)-5-oxopyrrolidin-3-yl]methanesulfonyl fluoride is sourced from PubChem (CID 168676283), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).