C28H30FNOS — CID 168677943
(1S,2R,13R,14S,17R,18S)-17-ethynyl-7-(3-fluorophenyl)-2,18-dimethyl-8-thia-6-azapentacyclo[11.7.0.02,10.05,9.014,18]icosa-5(9),6,10-trien-17-ol (PubChem CID 168677943) has the molecular formula C28H30FNOS and a molecular weight of 447.62 g/mol. Its IUPAC name is (1S,2R,13R,14S,17R,18S)-17-ethynyl-7-(3-fluorophenyl)-2,18-dimethyl-8-thia-6-azapentacyclo[11.7.0.02,10.05,9.014,18]icosa-5(9),6,10-trien-17-ol.
| Compound Name | (1S,2R,13R,14S,17R,18S)-17-ethynyl-7-(3-fluorophenyl)-2,18-dimethyl-8-thia-6-azapentacyclo[11.7.0.02,10.05,9.014,18]icosa-5(9),6,10-trien-17-ol |
|---|---|
| PubChem CID | 168677943 |
| Molecular Formula | C28H30FNOS |
| Molecular Weight | 447.62 g/mol |
| Exact Mass | 447.20 |
| IUPAC Name | (1S,2R,13R,14S,17R,18S)-17-ethynyl-7-(3-fluorophenyl)-2,18-dimethyl-8-thia-6-azapentacyclo[11.7.0.02,10.05,9.014,18]icosa-5(9),6,10-trien-17-ol |
| SMILES | C#C[C@]1(O)CC[C@H]2[C@@H]3CC=C4c5sc(-c6cccc(F)c6)nc5CC[C@]4(C)[C@H]3CC[C@@]21C |
| InChI | InChI=1S/C28H30FNOS/c1-4-28(31)15-11-21-19-8-9-22-24-23(30-25(32-24)17-6-5-7-18(29)16-17)12-13-26(22,2)20(19)10-14-27(21,28)3/h1,5-7,9,16,19-21,31H,8,10-15H2,2-3H3/t19-,20+,21+,26-,27+,28+/m1/s1 |
| InChIKey | SZOQUXCIWMFVTE-KFYXJCSSSA-N |
| XLogP | 6.50 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.62 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|