C6H12O4 — CID 168678286
(2S,6R)-2,6-dimethyl-1,3-dioxane-4,4-diol (PubChem CID 168678286) has the molecular formula C6H12O4 and a molecular weight of 148.16 g/mol. Its IUPAC name is (2S,6R)-2,6-dimethyl-1,3-dioxane-4,4-diol.
| Compound Name | (2S,6R)-2,6-dimethyl-1,3-dioxane-4,4-diol |
|---|---|
| PubChem CID | 168678286 |
| Molecular Formula | C6H12O4 |
| Molecular Weight | 148.16 g/mol |
| Exact Mass | 148.07 |
| IUPAC Name | (2S,6R)-2,6-dimethyl-1,3-dioxane-4,4-diol |
| SMILES | C[C@H]1O[C@H](C)CC(O)(O)O1 |
| InChI | InChI=1S/C6H12O4/c1-4-3-6(7,8)10-5(2)9-4/h4-5,7-8H,3H2,1-2H3/t4-,5+/m1/s1 |
| InChIKey | LLPWZEAIWVWWNV-UHNVWZDZSA-N |
| XLogP | -0.20 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 148.16 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|