About ethyl 2-[[4,6-bis(2-sulfanylethyl)pyrimidin-2-yl]-methylamino]acetate
ethyl 2-[[4,6-bis(2-sulfanylethyl)pyrimidin-2-yl]-methylamino]acetate (PubChem CID 168678289) has the molecular formula C13H21N3O2S2
and a molecular weight of 315.46 g/mol. Its IUPAC name is ethyl 2-[[4,6-bis(2-sulfanylethyl)pyrimidin-2-yl]-methylamino]acetate.
Molecular Properties
| Compound Name | ethyl 2-[[4,6-bis(2-sulfanylethyl)pyrimidin-2-yl]-methylamino]acetate |
| PubChem CID | 168678289 |
| Molecular Formula | C13H21N3O2S2 |
| Molecular Weight | 315.46 g/mol |
| Exact Mass | 315.11 |
| IUPAC Name | ethyl 2-[[4,6-bis(2-sulfanylethyl)pyrimidin-2-yl]-methylamino]acetate |
| SMILES | CCOC(=O)CN(C)c1nc(CCS)cc(CCS)n1 |
| InChI | InChI=1S/C13H21N3O2S2/c1-3-18-12(17)9-16(2)13-14-10(4-6-19)8-11(15-13)5-7-20/h8,19-20H,3-7,9H2,1-2H3 |
| InChIKey | GWGAKEZLMOOXLT-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 55.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 315.46 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze ethyl 2-[[4,6-bis(2-sulfanylethyl)pyrimidin-2-yl]-methylamino]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-[[4,6-bis(2-sulfanylethyl)pyrimidin-2-yl]-methylamino]acetate?
The IUPAC name of ethyl 2-[[4,6-bis(2-sulfanylethyl)pyrimidin-2-yl]-methylamino]acetate (CID 168678289) is ethyl 2-[[4,6-bis(2-sulfanylethyl)pyrimidin-2-yl]-methylamino]acetate.
What is the SMILES notation for ethyl 2-[[4,6-bis(2-sulfanylethyl)pyrimidin-2-yl]-methylamino]acetate?
The canonical SMILES for ethyl 2-[[4,6-bis(2-sulfanylethyl)pyrimidin-2-yl]-methylamino]acetate is CCOC(=O)CN(C)c1nc(CCS)cc(CCS)n1.
What is the InChIKey of ethyl 2-[[4,6-bis(2-sulfanylethyl)pyrimidin-2-yl]-methylamino]acetate?
The InChIKey is GWGAKEZLMOOXLT-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H21N3O2S2/c1-3-18-12(17)9-16(2)13-14-10(4-6-19)8-11(15-13)5-7-20/h8,19-20H,3-7,9H2,1-2H3.
What are the key properties of ethyl 2-[[4,6-bis(2-sulfanylethyl)pyrimidin-2-yl]-methylamino]acetate?
ethyl 2-[[4,6-bis(2-sulfanylethyl)pyrimidin-2-yl]-methylamino]acetate has a molecular weight of 315.46 g/mol, XLogP of 1.42, 8 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-[[4,6-bis(2-sulfanylethyl)pyrimidin-2-yl]-methylamino]acetate is sourced from PubChem (CID 168678289), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).