C21H13ClF2N4O3S — CID 168678340
5-chloro-N-[2,4-difluoro-3-[2-(1H-pyrrolo[2,3-b]pyridin-5-yl)ethynyl]phenyl]-2-methoxypyridine-3-sulfonamide (PubChem CID 168678340) has the molecular formula C21H13ClF2N4O3S and a molecular weight of 474.88 g/mol. Its IUPAC name is 5-chloro-N-[2,4-difluoro-3-[2-(1H-pyrrolo[2,3-b]pyridin-5-yl)ethynyl]phenyl]-2-methoxypyridine-3-sulfonamide.
| Compound Name | 5-chloro-N-[2,4-difluoro-3-[2-(1H-pyrrolo[2,3-b]pyridin-5-yl)ethynyl]phenyl]-2-methoxypyridine-3-sulfonamide |
|---|---|
| PubChem CID | 168678340 |
| Molecular Formula | C21H13ClF2N4O3S |
| Molecular Weight | 474.88 g/mol |
| Exact Mass | 474.04 |
| IUPAC Name | 5-chloro-N-[2,4-difluoro-3-[2-(1H-pyrrolo[2,3-b]pyridin-5-yl)ethynyl]phenyl]-2-methoxypyridine-3-sulfonamide |
| SMILES | COc1ncc(Cl)cc1S(=O)(=O)Nc1ccc(F)c(C#Cc2cnc3[nH]ccc3c2)c1F |
| InChI | InChI=1S/C21H13ClF2N4O3S/c1-31-21-18(9-14(22)11-27-21)32(29,30)28-17-5-4-16(23)15(19(17)24)3-2-12-8-13-6-7-25-20(13)26-10-12/h4-11,28H,1H3,(H,25,26) |
| InChIKey | BIQVITRPVMRHMA-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.88 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|