C19H15F5N6O2 — CID 168678346
(2E)-N-(5,6-difluoro-1H-indol-3-yl)-2-hydrazinylidene-3-[[5-methyl-6-(2,2,2-trifluoroethoxy)-3-pyridinyl]imino]propanamide (PubChem CID 168678346) has the molecular formula C19H15F5N6O2 and a molecular weight of 454.36 g/mol. Its IUPAC name is (2E)-N-(5,6-difluoro-1H-indol-3-yl)-2-hydrazinylidene-3-[[5-methyl-6-(2,2,2-trifluoroethoxy)-3-pyridinyl]imino]propanamide.
| Compound Name | (2E)-N-(5,6-difluoro-1H-indol-3-yl)-2-hydrazinylidene-3-[[5-methyl-6-(2,2,2-trifluoroethoxy)-3-pyridinyl]imino]propanamide |
|---|---|
| PubChem CID | 168678346 |
| Molecular Formula | C19H15F5N6O2 |
| Molecular Weight | 454.36 g/mol |
| Exact Mass | 454.12 |
| IUPAC Name | (2E)-N-(5,6-difluoro-1H-indol-3-yl)-2-hydrazinylidene-3-[[5-methyl-6-(2,2,2-trifluoroethoxy)-3-pyridinyl]imino]propanamide |
| SMILES | Cc1cc(/N=C/C(=N\N)C(=O)Nc2c[nH]c3cc(F)c(F)cc23)cnc1OCC(F)(F)F |
| InChI | InChI=1S/C19H15F5N6O2/c1-9-2-10(5-28-18(9)32-8-19(22,23)24)26-7-16(30-25)17(31)29-15-6-27-14-4-13(21)12(20)3-11(14)15/h2-7,27H,8,25H2,1H3,(H,29,31)/b26-7+,30-16+ |
| InChIKey | DSTSZPODHLYEFK-ZIVXJUIJSA-N |
| XLogP | 3.75 |
| TPSA | 117.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.36 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|