C17H21F3N4O2 — CID 168678766
[(1S,5R)-6-(5,5-dimethyl-4H-1,2-oxazol-3-yl)-3-azabicyclo[3.1.0]hexan-3-yl]-[1-(1,1,1-trifluoropropan-2-yl)imidazol-4-yl]methanone (PubChem CID 168678766) has the molecular formula C17H21F3N4O2 and a molecular weight of 370.38 g/mol. Its IUPAC name is [(1S,5R)-6-(5,5-dimethyl-4H-1,2-oxazol-3-yl)-3-azabicyclo[3.1.0]hexan-3-yl]-[1-(1,1,1-trifluoropropan-2-yl)imidazol-4-yl]methanone.
| Compound Name | [(1S,5R)-6-(5,5-dimethyl-4H-1,2-oxazol-3-yl)-3-azabicyclo[3.1.0]hexan-3-yl]-[1-(1,1,1-trifluoropropan-2-yl)imidazol-4-yl]methanone |
|---|---|
| PubChem CID | 168678766 |
| Molecular Formula | C17H21F3N4O2 |
| Molecular Weight | 370.38 g/mol |
| Exact Mass | 370.16 |
| IUPAC Name | [(1S,5R)-6-(5,5-dimethyl-4H-1,2-oxazol-3-yl)-3-azabicyclo[3.1.0]hexan-3-yl]-[1-(1,1,1-trifluoropropan-2-yl)imidazol-4-yl]methanone |
| SMILES | CC(n1cnc(C(=O)N2C[C@@H]3C(C4=NOC(C)(C)C4)[C@@H]3C2)c1)C(F)(F)F |
| InChI | InChI=1S/C17H21F3N4O2/c1-9(17(18,19)20)24-7-13(21-8-24)15(25)23-5-10-11(6-23)14(10)12-4-16(2,3)26-22-12/h7-11,14H,4-6H2,1-3H3/t9?,10-,11+,14? |
| InChIKey | TUZBNSGQDAGILF-ZNBHRWMRSA-N |
| XLogP | 2.88 |
| TPSA | 59.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.38 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |