C29H28F6N3O3- — CID 168678894
2-[(2S)-4-[[4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-3-methylphenyl]methyl]-1-(pyridin-4-ylmethyl)piperazin-2-yl]acetate (PubChem CID 168678894) has the molecular formula C29H28F6N3O3- and a molecular weight of 580.55 g/mol. Its IUPAC name is 2-[(2S)-4-[[4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-3-methylphenyl]methyl]-1-(pyridin-4-ylmethyl)piperazin-2-yl]acetate.
| Compound Name | 2-[(2S)-4-[[4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-3-methylphenyl]methyl]-1-(pyridin-4-ylmethyl)piperazin-2-yl]acetate |
|---|---|
| PubChem CID | 168678894 |
| Molecular Formula | C29H28F6N3O3- |
| Molecular Weight | 580.55 g/mol |
| Exact Mass | 580.20 |
| IUPAC Name | 2-[(2S)-4-[[4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-3-methylphenyl]methyl]-1-(pyridin-4-ylmethyl)piperazin-2-yl]acetate |
| SMILES | Cc1cc(CN2CCN(Cc3ccncc3)[C@@H](CC(=O)[O-])C2)ccc1-c1ccc(C(O)(C(F)(F)F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C29H29F6N3O3/c1-19-14-21(16-37-12-13-38(24(18-37)15-26(39)40)17-20-8-10-36-11-9-20)2-7-25(19)22-3-5-23(6-4-22)27(41,28(30,31)32)29(33,34)35/h2-11,14,24,41H,12-13,15-18H2,1H3,(H,39,40)/p-1/t24-/m0/s1 |
| InChIKey | DNRQYNYSRNRKME-DEOSSOPVSA-M |
| XLogP | 4.20 |
| TPSA | 79.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.55 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |