C24H31ClN4O — CID 168678982
(3S,7S,8aS)-3-[(4-chlorophenyl)methyl]-2-(1-pyridin-2-ylpiperidin-4-yl)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-7-ol (PubChem CID 168678982) has the molecular formula C24H31ClN4O and a molecular weight of 426.99 g/mol. Its IUPAC name is (3S,7S,8aS)-3-[(4-chlorophenyl)methyl]-2-(1-pyridin-2-ylpiperidin-4-yl)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-7-ol.
| Compound Name | (3S,7S,8aS)-3-[(4-chlorophenyl)methyl]-2-(1-pyridin-2-ylpiperidin-4-yl)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-7-ol |
|---|---|
| PubChem CID | 168678982 |
| Molecular Formula | C24H31ClN4O |
| Molecular Weight | 426.99 g/mol |
| Exact Mass | 426.22 |
| IUPAC Name | (3S,7S,8aS)-3-[(4-chlorophenyl)methyl]-2-(1-pyridin-2-ylpiperidin-4-yl)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-7-ol |
| SMILES | O[C@H]1C[C@H]2CN(C3CCN(c4ccccn4)CC3)[C@@H](Cc3ccc(Cl)cc3)CN2C1 |
| InChI | InChI=1S/C24H31ClN4O/c25-19-6-4-18(5-7-19)13-22-15-28-17-23(30)14-21(28)16-29(22)20-8-11-27(12-9-20)24-3-1-2-10-26-24/h1-7,10,20-23,30H,8-9,11-17H2/t21-,22-,23-/m0/s1 |
| InChIKey | JRMGQDCSKBEGQE-VABKMULXSA-N |
| XLogP | 3.07 |
| TPSA | 42.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.99 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |