C25H33ClN4 — CID 168679003
(3S,9aS)-3-[(4-chlorophenyl)methyl]-2-(1-pyridin-2-ylpiperidin-4-yl)-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazine (PubChem CID 168679003) has the molecular formula C25H33ClN4 and a molecular weight of 425.02 g/mol. Its IUPAC name is (3S,9aS)-3-[(4-chlorophenyl)methyl]-2-(1-pyridin-2-ylpiperidin-4-yl)-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazine.
| Compound Name | (3S,9aS)-3-[(4-chlorophenyl)methyl]-2-(1-pyridin-2-ylpiperidin-4-yl)-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazine |
|---|---|
| PubChem CID | 168679003 |
| Molecular Formula | C25H33ClN4 |
| Molecular Weight | 425.02 g/mol |
| Exact Mass | 424.24 |
| IUPAC Name | (3S,9aS)-3-[(4-chlorophenyl)methyl]-2-(1-pyridin-2-ylpiperidin-4-yl)-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazine |
| SMILES | Clc1ccc(C[C@H]2CN3CCCC[C@H]3CN2C2CCN(c3ccccn3)CC2)cc1 |
| InChI | InChI=1S/C25H33ClN4/c26-21-9-7-20(8-10-21)17-24-18-29-14-4-2-5-23(29)19-30(24)22-11-15-28(16-12-22)25-6-1-3-13-27-25/h1,3,6-10,13,22-24H,2,4-5,11-12,14-19H2/t23-,24-/m0/s1 |
| InChIKey | AOSKFYIBNCPVDO-ZEQRLZLVSA-N |
| XLogP | 4.49 |
| TPSA | 22.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.02 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |