C31H32ClFN6O2 — CID 168679303
(1R,6R)-3-[7-(8-chloronaphthalen-1-yl)-8-fluoro-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)pyrido[4,3-d]pyrimidin-4-yl]-3,8-diazabicyclo[3.2.1]octan-6-ol (PubChem CID 168679303) has the molecular formula C31H32ClFN6O2 and a molecular weight of 575.09 g/mol. Its IUPAC name is (1R,6R)-3-[7-(8-chloronaphthalen-1-yl)-8-fluoro-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)pyrido[4,3-d]pyrimidin-4-yl]-3,8-diazabicyclo[3.2.1]octan-6-ol.
| Compound Name | (1R,6R)-3-[7-(8-chloronaphthalen-1-yl)-8-fluoro-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)pyrido[4,3-d]pyrimidin-4-yl]-3,8-diazabicyclo[3.2.1]octan-6-ol |
|---|---|
| PubChem CID | 168679303 |
| Molecular Formula | C31H32ClFN6O2 |
| Molecular Weight | 575.09 g/mol |
| Exact Mass | 574.23 |
| IUPAC Name | (1R,6R)-3-[7-(8-chloronaphthalen-1-yl)-8-fluoro-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)pyrido[4,3-d]pyrimidin-4-yl]-3,8-diazabicyclo[3.2.1]octan-6-ol |
| SMILES | O[C@@H]1C[C@@H]2CN(c3nc(OCC45CCCN4CCC5)nc4c(F)c(-c5cccc6cccc(Cl)c56)ncc34)CC1N2 |
| InChI | InChI=1S/C31H32ClFN6O2/c32-22-8-2-6-18-5-1-7-20(25(18)22)27-26(33)28-21(14-34-27)29(38-15-19-13-24(40)23(16-38)35-19)37-30(36-28)41-17-31-9-3-11-39(31)12-4-10-31/h1-2,5-8,14,19,23-24,35,40H,3-4,9-13,15-17H2/t19-,23?,24-/m1/s1 |
| InChIKey | UFXISIXNZYGHFD-PAOFMCMWSA-N |
| XLogP | 4.56 |
| TPSA | 86.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.09 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |