C9H11IN2O — CID 168679995
N-cyclopropyl-4-iodo-1-methylpyrrole-2-carboxamide (PubChem CID 168679995) has the molecular formula C9H11IN2O and a molecular weight of 290.10 g/mol. Its IUPAC name is N-cyclopropyl-4-iodo-1-methylpyrrole-2-carboxamide.
| Compound Name | N-cyclopropyl-4-iodo-1-methylpyrrole-2-carboxamide |
|---|---|
| PubChem CID | 168679995 |
| Molecular Formula | C9H11IN2O |
| Molecular Weight | 290.10 g/mol |
| Exact Mass | 289.99 |
| IUPAC Name | N-cyclopropyl-4-iodo-1-methylpyrrole-2-carboxamide |
| SMILES | Cn1cc(I)cc1C(=O)NC1CC1 |
| InChI | InChI=1S/C9H11IN2O/c1-12-5-6(10)4-8(12)9(13)11-7-2-3-7/h4-5,7H,2-3H2,1H3,(H,11,13) |
| InChIKey | PWHABURBIKCQIY-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 34.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.10 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|