C16H21O7-3 — CID 168680081
(4E,11E)-2-hydroxytrideca-4,11-diene-1,2,3-tricarboxylate (PubChem CID 168680081) has the molecular formula C16H21O7-3 and a molecular weight of 325.34 g/mol. Its IUPAC name is (4E,11E)-2-hydroxytrideca-4,11-diene-1,2,3-tricarboxylate.
| Compound Name | (4E,11E)-2-hydroxytrideca-4,11-diene-1,2,3-tricarboxylate |
|---|---|
| PubChem CID | 168680081 |
| Molecular Formula | C16H21O7-3 |
| Molecular Weight | 325.34 g/mol |
| Exact Mass | 325.13 |
| IUPAC Name | (4E,11E)-2-hydroxytrideca-4,11-diene-1,2,3-tricarboxylate |
| SMILES | C/C=C/CCCCC/C=C/C(C(=O)[O-])C(O)(CC(=O)[O-])C(=O)[O-] |
| InChI | InChI=1S/C16H24O7/c1-2-3-4-5-6-7-8-9-10-12(14(19)20)16(23,15(21)22)11-13(17)18/h2-3,9-10,12,23H,4-8,11H2,1H3,(H,17,18)(H,19,20)(H,21,22)/p-3/b3-2+,10-9+ |
| InChIKey | UVLMDUFYHADCCX-SCIPBJTFSA-K |
| XLogP | -1.94 |
| TPSA | 140.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.34 |
| LogP ≤ 5 | -1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|