C9H15N3O7S2 — CID 168680124
(2S,3S)-2-methyl-4-oxo-3-[2-oxo-4-(sulfamoylmethyl)pyrrolidin-1-yl]azetidine-1-sulfonic acid (PubChem CID 168680124) has the molecular formula C9H15N3O7S2 and a molecular weight of 341.37 g/mol. Its IUPAC name is (2S,3S)-2-methyl-4-oxo-3-[2-oxo-4-(sulfamoylmethyl)pyrrolidin-1-yl]azetidine-1-sulfonic acid.
| Compound Name | (2S,3S)-2-methyl-4-oxo-3-[2-oxo-4-(sulfamoylmethyl)pyrrolidin-1-yl]azetidine-1-sulfonic acid |
|---|---|
| PubChem CID | 168680124 |
| Molecular Formula | C9H15N3O7S2 |
| Molecular Weight | 341.37 g/mol |
| Exact Mass | 341.04 |
| IUPAC Name | (2S,3S)-2-methyl-4-oxo-3-[2-oxo-4-(sulfamoylmethyl)pyrrolidin-1-yl]azetidine-1-sulfonic acid |
| SMILES | C[C@H]1[C@H](N2CC(CS(N)(=O)=O)CC2=O)C(=O)N1S(=O)(=O)O |
| InChI | InChI=1S/C9H15N3O7S2/c1-5-8(9(14)12(5)21(17,18)19)11-3-6(2-7(11)13)4-20(10,15)16/h5-6,8H,2-4H2,1H3,(H2,10,15,16)(H,17,18,19)/t5-,6?,8-/m0/s1 |
| InChIKey | HLSNMTYSPCMDLY-MMFDLBQYSA-N |
| XLogP | -2.47 |
| TPSA | 155.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.37 |
| LogP ≤ 5 | -2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|