About [1-(5-hydroxy-4,4-dimethylpentyl)-5-oxopyrrolidin-3-yl]methanesulfonamide
[1-(5-hydroxy-4,4-dimethylpentyl)-5-oxopyrrolidin-3-yl]methanesulfonamide (PubChem CID 168680624) has the molecular formula C12H24N2O4S
and a molecular weight of 292.40 g/mol. Its IUPAC name is [1-(5-hydroxy-4,4-dimethylpentyl)-5-oxopyrrolidin-3-yl]methanesulfonamide.
Molecular Properties
| Compound Name | [1-(5-hydroxy-4,4-dimethylpentyl)-5-oxopyrrolidin-3-yl]methanesulfonamide |
| PubChem CID | 168680624 |
| Molecular Formula | C12H24N2O4S |
| Molecular Weight | 292.40 g/mol |
| Exact Mass | 292.15 |
| IUPAC Name | [1-(5-hydroxy-4,4-dimethylpentyl)-5-oxopyrrolidin-3-yl]methanesulfonamide |
| SMILES | CC(C)(CO)CCCN1CC(CS(N)(=O)=O)CC1=O |
| InChI | InChI=1S/C12H24N2O4S/c1-12(2,9-15)4-3-5-14-7-10(6-11(14)16)8-19(13,17)18/h10,15H,3-9H2,1-2H3,(H2,13,17,18) |
| InChIKey | YIKGDSGMDJNPBM-UHFFFAOYSA-N |
| XLogP | -0.08 |
| TPSA | 100.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.40 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [1-(5-hydroxy-4,4-dimethylpentyl)-5-oxopyrrolidin-3-yl]methanesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-(5-hydroxy-4,4-dimethylpentyl)-5-oxopyrrolidin-3-yl]methanesulfonamide?
The IUPAC name of [1-(5-hydroxy-4,4-dimethylpentyl)-5-oxopyrrolidin-3-yl]methanesulfonamide (CID 168680624) is [1-(5-hydroxy-4,4-dimethylpentyl)-5-oxopyrrolidin-3-yl]methanesulfonamide.
What is the SMILES notation for [1-(5-hydroxy-4,4-dimethylpentyl)-5-oxopyrrolidin-3-yl]methanesulfonamide?
The canonical SMILES for [1-(5-hydroxy-4,4-dimethylpentyl)-5-oxopyrrolidin-3-yl]methanesulfonamide is CC(C)(CO)CCCN1CC(CS(N)(=O)=O)CC1=O.
What is the InChIKey of [1-(5-hydroxy-4,4-dimethylpentyl)-5-oxopyrrolidin-3-yl]methanesulfonamide?
The InChIKey is YIKGDSGMDJNPBM-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H24N2O4S/c1-12(2,9-15)4-3-5-14-7-10(6-11(14)16)8-19(13,17)18/h10,15H,3-9H2,1-2H3,(H2,13,17,18).
What are the key properties of [1-(5-hydroxy-4,4-dimethylpentyl)-5-oxopyrrolidin-3-yl]methanesulfonamide?
[1-(5-hydroxy-4,4-dimethylpentyl)-5-oxopyrrolidin-3-yl]methanesulfonamide has a molecular weight of 292.40 g/mol, XLogP of -0.08, 7 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [1-(5-hydroxy-4,4-dimethylpentyl)-5-oxopyrrolidin-3-yl]methanesulfonamide is sourced from PubChem (CID 168680624), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).