About [1-(2,2-dimethyl-1,3-dioxan-5-yl)-5-oxopyrrolidin-3-yl]methanesulfonamide
[1-(2,2-dimethyl-1,3-dioxan-5-yl)-5-oxopyrrolidin-3-yl]methanesulfonamide (PubChem CID 168680635) has the molecular formula C11H20N2O5S
and a molecular weight of 292.36 g/mol. Its IUPAC name is [1-(2,2-dimethyl-1,3-dioxan-5-yl)-5-oxopyrrolidin-3-yl]methanesulfonamide.
Molecular Properties
| Compound Name | [1-(2,2-dimethyl-1,3-dioxan-5-yl)-5-oxopyrrolidin-3-yl]methanesulfonamide |
| PubChem CID | 168680635 |
| Molecular Formula | C11H20N2O5S |
| Molecular Weight | 292.36 g/mol |
| Exact Mass | 292.11 |
| IUPAC Name | [1-(2,2-dimethyl-1,3-dioxan-5-yl)-5-oxopyrrolidin-3-yl]methanesulfonamide |
| SMILES | CC1(C)OCC(N2CC(CS(N)(=O)=O)CC2=O)CO1 |
| InChI | InChI=1S/C11H20N2O5S/c1-11(2)17-5-9(6-18-11)13-4-8(3-10(13)14)7-19(12,15)16/h8-9H,3-7H2,1-2H3,(H2,12,15,16) |
| InChIKey | SXEXDHJITKKBDX-UHFFFAOYSA-N |
| XLogP | -0.73 |
| TPSA | 98.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.36 |
| LogP ≤ 5 | -0.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [1-(2,2-dimethyl-1,3-dioxan-5-yl)-5-oxopyrrolidin-3-yl]methanesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-(2,2-dimethyl-1,3-dioxan-5-yl)-5-oxopyrrolidin-3-yl]methanesulfonamide?
The IUPAC name of [1-(2,2-dimethyl-1,3-dioxan-5-yl)-5-oxopyrrolidin-3-yl]methanesulfonamide (CID 168680635) is [1-(2,2-dimethyl-1,3-dioxan-5-yl)-5-oxopyrrolidin-3-yl]methanesulfonamide.
What is the SMILES notation for [1-(2,2-dimethyl-1,3-dioxan-5-yl)-5-oxopyrrolidin-3-yl]methanesulfonamide?
The canonical SMILES for [1-(2,2-dimethyl-1,3-dioxan-5-yl)-5-oxopyrrolidin-3-yl]methanesulfonamide is CC1(C)OCC(N2CC(CS(N)(=O)=O)CC2=O)CO1.
What is the InChIKey of [1-(2,2-dimethyl-1,3-dioxan-5-yl)-5-oxopyrrolidin-3-yl]methanesulfonamide?
The InChIKey is SXEXDHJITKKBDX-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20N2O5S/c1-11(2)17-5-9(6-18-11)13-4-8(3-10(13)14)7-19(12,15)16/h8-9H,3-7H2,1-2H3,(H2,12,15,16).
What are the key properties of [1-(2,2-dimethyl-1,3-dioxan-5-yl)-5-oxopyrrolidin-3-yl]methanesulfonamide?
[1-(2,2-dimethyl-1,3-dioxan-5-yl)-5-oxopyrrolidin-3-yl]methanesulfonamide has a molecular weight of 292.36 g/mol, XLogP of -0.73, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [1-(2,2-dimethyl-1,3-dioxan-5-yl)-5-oxopyrrolidin-3-yl]methanesulfonamide is sourced from PubChem (CID 168680635), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).