C15H21ClN2O3S — CID 168680890
[1-(3-chloro-2,6-diethylphenyl)-5-oxopyrrolidin-3-yl]methanesulfonamide (PubChem CID 168680890) has the molecular formula C15H21ClN2O3S and a molecular weight of 344.86 g/mol. Its IUPAC name is [1-(3-chloro-2,6-diethylphenyl)-5-oxopyrrolidin-3-yl]methanesulfonamide.
| Compound Name | [1-(3-chloro-2,6-diethylphenyl)-5-oxopyrrolidin-3-yl]methanesulfonamide |
|---|---|
| PubChem CID | 168680890 |
| Molecular Formula | C15H21ClN2O3S |
| Molecular Weight | 344.86 g/mol |
| Exact Mass | 344.10 |
| IUPAC Name | [1-(3-chloro-2,6-diethylphenyl)-5-oxopyrrolidin-3-yl]methanesulfonamide |
| SMILES | CCc1ccc(Cl)c(CC)c1N1CC(CS(N)(=O)=O)CC1=O |
| InChI | InChI=1S/C15H21ClN2O3S/c1-3-11-5-6-13(16)12(4-2)15(11)18-8-10(7-14(18)19)9-22(17,20)21/h5-6,10H,3-4,7-9H2,1-2H3,(H2,17,20,21) |
| InChIKey | FXOMRNNQRCCHFX-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 80.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.86 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |