C9H18N2O4S — CID 168681092
[1-(3-methoxypropyl)-5-oxopyrrolidin-3-yl]methanesulfonamide (PubChem CID 168681092) has the molecular formula C9H18N2O4S and a molecular weight of 250.32 g/mol. Its IUPAC name is [1-(3-methoxypropyl)-5-oxopyrrolidin-3-yl]methanesulfonamide.
| Compound Name | [1-(3-methoxypropyl)-5-oxopyrrolidin-3-yl]methanesulfonamide |
|---|---|
| PubChem CID | 168681092 |
| Molecular Formula | C9H18N2O4S |
| Molecular Weight | 250.32 g/mol |
| Exact Mass | 250.10 |
| IUPAC Name | [1-(3-methoxypropyl)-5-oxopyrrolidin-3-yl]methanesulfonamide |
| SMILES | COCCCN1CC(CS(N)(=O)=O)CC1=O |
| InChI | InChI=1S/C9H18N2O4S/c1-15-4-2-3-11-6-8(5-9(11)12)7-16(10,13)14/h8H,2-7H2,1H3,(H2,10,13,14) |
| InChIKey | UAJKPHYGCNZGLH-UHFFFAOYSA-N |
| XLogP | -0.84 |
| TPSA | 89.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.32 |
| LogP ≤ 5 | -0.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|