About [1-[2-(1,3-oxazol-5-yl)ethyl]-5-oxopyrrolidin-3-yl]methanesulfonamide
[1-[2-(1,3-oxazol-5-yl)ethyl]-5-oxopyrrolidin-3-yl]methanesulfonamide (PubChem CID 168682019) has the molecular formula C10H15N3O4S
and a molecular weight of 273.31 g/mol. Its IUPAC name is [1-[2-(1,3-oxazol-5-yl)ethyl]-5-oxopyrrolidin-3-yl]methanesulfonamide.
Molecular Properties
| Compound Name | [1-[2-(1,3-oxazol-5-yl)ethyl]-5-oxopyrrolidin-3-yl]methanesulfonamide |
| PubChem CID | 168682019 |
| Molecular Formula | C10H15N3O4S |
| Molecular Weight | 273.31 g/mol |
| Exact Mass | 273.08 |
| IUPAC Name | [1-[2-(1,3-oxazol-5-yl)ethyl]-5-oxopyrrolidin-3-yl]methanesulfonamide |
| SMILES | NS(=O)(=O)CC1CC(=O)N(CCc2cnco2)C1 |
| InChI | InChI=1S/C10H15N3O4S/c11-18(15,16)6-8-3-10(14)13(5-8)2-1-9-4-12-7-17-9/h4,7-8H,1-3,5-6H2,(H2,11,15,16) |
| InChIKey | RGNWOKPGIUYWDB-UHFFFAOYSA-N |
| XLogP | -0.65 |
| TPSA | 106.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.31 |
| LogP ≤ 5 | -0.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [1-[2-(1,3-oxazol-5-yl)ethyl]-5-oxopyrrolidin-3-yl]methanesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-[2-(1,3-oxazol-5-yl)ethyl]-5-oxopyrrolidin-3-yl]methanesulfonamide?
The IUPAC name of [1-[2-(1,3-oxazol-5-yl)ethyl]-5-oxopyrrolidin-3-yl]methanesulfonamide (CID 168682019) is [1-[2-(1,3-oxazol-5-yl)ethyl]-5-oxopyrrolidin-3-yl]methanesulfonamide.
What is the SMILES notation for [1-[2-(1,3-oxazol-5-yl)ethyl]-5-oxopyrrolidin-3-yl]methanesulfonamide?
The canonical SMILES for [1-[2-(1,3-oxazol-5-yl)ethyl]-5-oxopyrrolidin-3-yl]methanesulfonamide is NS(=O)(=O)CC1CC(=O)N(CCc2cnco2)C1.
What is the InChIKey of [1-[2-(1,3-oxazol-5-yl)ethyl]-5-oxopyrrolidin-3-yl]methanesulfonamide?
The InChIKey is RGNWOKPGIUYWDB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15N3O4S/c11-18(15,16)6-8-3-10(14)13(5-8)2-1-9-4-12-7-17-9/h4,7-8H,1-3,5-6H2,(H2,11,15,16).
What are the key properties of [1-[2-(1,3-oxazol-5-yl)ethyl]-5-oxopyrrolidin-3-yl]methanesulfonamide?
[1-[2-(1,3-oxazol-5-yl)ethyl]-5-oxopyrrolidin-3-yl]methanesulfonamide has a molecular weight of 273.31 g/mol, XLogP of -0.65, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [1-[2-(1,3-oxazol-5-yl)ethyl]-5-oxopyrrolidin-3-yl]methanesulfonamide is sourced from PubChem (CID 168682019), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).