C18H24N2O — CID 168683832
1-[(3R)-1-benzylpiperidin-3-yl]-4-ethenylpyrrolidin-2-one (PubChem CID 168683832) has the molecular formula C18H24N2O and a molecular weight of 284.40 g/mol. Its IUPAC name is 1-[(3R)-1-benzylpiperidin-3-yl]-4-ethenylpyrrolidin-2-one.
| Compound Name | 1-[(3R)-1-benzylpiperidin-3-yl]-4-ethenylpyrrolidin-2-one |
|---|---|
| PubChem CID | 168683832 |
| Molecular Formula | C18H24N2O |
| Molecular Weight | 284.40 g/mol |
| Exact Mass | 284.19 |
| IUPAC Name | 1-[(3R)-1-benzylpiperidin-3-yl]-4-ethenylpyrrolidin-2-one |
| SMILES | C=CC1CC(=O)N([C@@H]2CCCN(Cc3ccccc3)C2)C1 |
| InChI | InChI=1S/C18H24N2O/c1-2-15-11-18(21)20(13-15)17-9-6-10-19(14-17)12-16-7-4-3-5-8-16/h2-5,7-8,15,17H,1,6,9-14H2/t15?,17-/m1/s1 |
| InChIKey | SBSWBRLIBPBMRU-OMOCHNIRSA-N |
| XLogP | 2.69 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.40 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|